Eicosa-11,14-dienoic acid
PubChem CID: 5282805
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 11,14-Eicosadienoic acid, 2091-39-6, Eicosadienoic acid, (11E,14E)-icosa-11,14-dienoic acid, 11, 14-icosadienoic acid, 11C,14C-EICOSADIENOICACID, C20:2n-6,9, 11,14-trans-Eicosadienoic acid, HOMO-GAMMA-LINOLEICACID, 11(Z),14(Z)-Eicosadienoic Acid, 11,14-Eicosadienoicacid, eicosa-11z,14z-dienoic acid, DTXSID101312766, MFCD00673431, Eicosadienoic acid?, n-6 eicosadienoic acid, delta11,14-20:2, 11C 14C-Eicosadienoic Acid, SCHEMBL278058, CHEBI:93415, CHEBI:194379, XSXIVVZCUAHUJO-AVQMFFATSA-N, DTXCID301440432, all-cis-11,14-eicosadienoic acid, LMFA01030130, AKOS037645200, AS-58338, AS-87424, HY-113130, CS-0059956, G12053, 680-553-8 |
|---|---|
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 22.0 |
| Description | Isolated from lipids of Ginkgo biloba (ginkgo) Eicosadienoic acid is an omega 6 fatty acid found in human milk (PMID: 15256803). Omega-6 fatty acids) are a family of unsaturated fatty acids which have in common a carbon-carbon double bond in the n−, 6 position, that is, the sixth bond from the end of the fatty acid. The biological effects of the omega−, 6 fatty acids are largely mediated by their conversion to n-6 eicosanoids that bind to diverse receptors found in every tissue of the body. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 292.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (11E,14E)-icosa-11,14-dienoic acid |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Xlogp | 7.9 |
| Is Pains | False |
| Molecular Formula | C20H36O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | XSXIVVZCUAHUJO-AVQMFFATSA-N |
| Fcsp3 | 0.75 |
| Logs | -3.37 |
| Rotatable Bond Count | 16.0 |
| State | Solid |
| Logd | 0.753 |
| Synonyms | (11Z,14Z)-Eicosa-11,14-dienoate, (11Z,14Z)-Eicosa-11,14-dienoic acid, (11Z,14Z)-Icosa-11,14-dienoate, (11Z,14Z)-Icosa-11,14-dienoic acid, 11, 14-icosadienoate, 11, 14-icosadienoic acid, 11,14-Eicosadienoate, 11,14-Eicosadienoic acid, 11,14-Eicosadienoic acid, (Z,Z)-, 11,14-Icosadienoate, 11,14-Icosadienoic acid, cis-11,14-Eicosadienoic acid, Eicosadienoate, Eicosadienoic acid, Homo-gamma-linoleic acid, Icosadienoic acid, Prop-2-ynyltriphenylphosphonium Bromide |
| Compound Name | Eicosa-11,14-dienoic acid |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 308.272 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 308.272 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 308.5 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Esol | -5.761937199999999 |
| Inchi | InChI=1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22)/b7-6+,10-9+ |
| Smiles | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)O |
| Nring | 5.0 |
| Defined Bond Stereocenter Count | 2.0 |
- 1. Outgoing r'ship
FOUND_INto/from Juglans Regia (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Raphanus Sativus (Plant) Rel Props:Source_db:cmaup_ingredients