2,4-Decadienoic acid, (2E,4E)-
PubChem CID: 5282782
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (2E,4E)-2,4-Decadienoic acid, 30361-33-2, (2E,4E)-deca-2,4-dienoic acid, 2,4-Decadienoic acid, (2E,4E)-, 2,4-Decadienoic acid, FGJ89HQ9GR, EINECS 250-149-2, 2E,4E-decadienoic acid, (2E,4E)-Decadienoic acid, 2-trans,4-trans-Decadienoic acid, DTXSID401026609, trans-2, trans-4-decadienoic acid, 544-48-9, 2,4-Decadienoic acid, trans-2,trans-4-, deca-2,4-dienoic acid, (2E,4Z)-2,4-Decadienoic acid, C10:2n-6,8, CBV8Q5WA6X, Decadienoic acid, 2,4-Decadienoic acid, (2E,4Z)-, (E,E)-2,4-Decadienoic Acid, 2(E),4(E)-Decadienoic Acid, 2-trans,4-trans-Decadienoic Acid, trans-2-trans-4-Decadienoic Acid, EINECS 208-872-6, 2,4-Decadienoicacid, UNII-CBV8Q5WA6X, UNII-FGJ89HQ9GR, SCHEMBL258255, (E,E)-2,4-Decadienoic Acid, CHEBI:72614, DTXCID90911070, trans,trans-2,4-decadienoic acid, HY-N10751, LMFA01030104, AKOS006294474, DB-257537, CS-0634409, NS00083827, G88946, EN300-25092854, Q27140018, 250-149-2, 92015-76-4 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Unsaturated fatty acids |
| Deep Smiles | CCCCC/C=C/C=C/C=O)O |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty acids and conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 169.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (2E,4E)-deca-2,4-dienoic acid |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.3 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H16O2 |
| Inchi Key | YKHVVNDSWHSBPA-BLHCBFLLSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 6.0 |
| Synonyms | decadienoic acid |
| Esol Class | Soluble |
| Functional Groups | C/C=C/C=C/C(=O)O |
| Compound Name | 2,4-Decadienoic acid, (2E,4E)- |
| Exact Mass | 168.115 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 168.115 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 168.23 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H16O2/c1-2-3-4-5-6-7-8-9-10(11)12/h6-9H,2-5H2,1H3,(H,11,12)/b7-6+,9-8+ |
| Smiles | CCCCC/C=C/C=C/C(=O)O |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 2.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty Acids and Conjugates |
- 1. Outgoing r'ship
FOUND_INto/from Euphorbia Lathyris (Plant) Rel Props:Reference:ISBN:9788185042114