(5Z)-5-octenoic acid
PubChem CID: 5282718
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | cis-5-octenoic acid, (Z)-5-Octenoic acid, 5-Octenoic acid, (5Z)-, (5Z)-5-octenoic acid, Octenoic acid, 5Z-octenoic acid, (Z)-oct-5-enoic acid, 6OL5TNF5WG, 41653-97-8, UNII-6OL5TNF5WG, (5Z)-octenoic acid, cis-delta-octenoic acid, (5Z)-oct-5-enoic acid, 5-OCTENOIC ACID, CIS-, FEMA NO. 4350, FEMA 4350, CHEBI:176781, 5-OCTENOIC ACID, (Z)-, CIS-5-OCTENOIC ACID [FHFI], C8:1n-3, SCHEMBL583941, RRGOKSYVAZDNKR-ARJAWSKDSA-N, LMFA01030022, AKOS006377827, Q27265237 |
|---|---|
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 10.0 |
| Description | Cis-5-octenoic acid, also known as cis-5-octenoate, is a member of the class of compounds known as medium-chain fatty acids. Medium-chain fatty acids are fatty acids with an aliphatic tail that contains between 4 and 12 carbon atoms. Thus, cis-5-octenoic acid is considered to be a fatty acid lipid molecule. Cis-5-octenoic acid is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Cis-5-octenoic acid has a fatty and greasy taste. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 116.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (Z)-oct-5-enoic acid |
| Nih Violation | False |
| Class | Fatty Acyls |
| Xlogp | 1.9 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty acids and conjugates |
| Molecular Formula | C8H14O2 |
| Inchi Key | RRGOKSYVAZDNKR-ARJAWSKDSA-N |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Synonyms | hex-3-en-1-yl acetate, (5Z)-Octenoic acid, (Z)-5-Octenoic acid, (Z)-Oct-5-enoic acid, 5Z-Octenoic acid, FEMA 4350, (5Z)-Octenoate, (Z)-5-Octenoate, (Z)-Oct-5-enoate, 5Z-Octenoate, cis-5-Octenoate, (5Z)-5-Octenoic acid, 5E-Octenoic acid, cis-delta-Octenoate, cis-Δ-octenoate, cis-Δ-octenoic acid, Hex-3-en-1-yl acetic acid |
| Compound Name | (5Z)-5-octenoic acid |
| Kingdom | Organic compounds |
| Exact Mass | 142.099 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 142.099 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 142.2 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h3-4H,2,5-7H2,1H3,(H,9,10)/b4-3- |
| Smiles | CC/C=C\CCCC(=O)O |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Medium-chain fatty acids |
- 1. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Source_db:fooddb_chem_all