Diferulic acid
PubChem CID: 5281770
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Diferulic acid, 8-5'-b diferulic acid, 60299-54-9, C10446, (2E,2'E)-3,3'-(6,6'-dihydroxy-5,5'-dimethoxy-[1,1'-biphenyl]-3,3'-diyl)diacrylic acid, (E)-3-[3-[5-[(E)-2-carboxyethenyl]-2-hydroxy-3-methoxyphenyl]-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid, (E)-3-[3-[5-[(E)-2-carboxyvinyl]-2-hydroxy-3-methoxy-phenyl]-4-hydroxy-5-methoxy-phenyl]prop-2-enoic acid, AC1NQZ1N, (E)-3-(3-(5-((E)-2-carboxyethenyl)-2-hydroxy-3-methoxyphenyl)-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid, (E)-3-(3-(5-((E)-2-carboxyvinyl)-2-hydroxy-3-methoxy-phenyl)-4-hydroxy-5-methoxy-phenyl)prop-2-enoic acid, 8-5'-Diferulic acid, SCHEMBL20886492, 2-Propenoic acid,3,3'-(6,6'-dihydroxy-5,5'-dimethoxy[1,1'-biphenyl]-3,3'-diyl)bis-, (2E,2'E)-, AT37109, 3,3'-(6,6'-Dihydroxy-5,5'-dimethoxy-[1,1'-biphenyl]-3,3'-diyl)diacrylic acid |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 134.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCC(C2CCCCC2)CC1 |
| Np Classifier Class | Cinnamic acids and derivatives, Neolignans |
| Deep Smiles | COccc/C=C/C=O)O))))ccc6O))ccc/C=C/C=O)O))))ccc6O))OC |
| Heavy Atom Count | 28.0 |
| Classyfire Class | Benzene and substituted derivatives |
| Description | 5-5'-dehydrodiferulic acid, also known as 8-O-4'-diferulic acid, belongs to biphenyls and derivatives class of compounds. Those are organic compounds containing to benzene rings linked together by a C-C bond. 5-5'-dehydrodiferulic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). 5-5'-dehydrodiferulic acid can be found in a number of food items such as corn, common wheat, semolina, and hard wheat, which makes 5-5'-dehydrodiferulic acid a potential biomarker for the consumption of these food products. |
| Scaffold Graph Node Level | C1CCC(C2CCCCC2)CC1 |
| Classyfire Subclass | Biphenyls and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 549.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (E)-3-[3-[5-[(E)-2-carboxyethenyl]-2-hydroxy-3-methoxyphenyl]-4-hydroxy-5-methoxyphenyl]prop-2-enoic acid |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 2.7 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C20H18O8 |
| Scaffold Graph Node Bond Level | c1ccc(-c2ccccc2)cc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | LBQZVWQOPFFQJI-GGWOSOGESA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.1 |
| Rotatable Bond Count | 7.0 |
| Synonyms | diferulic acid |
| Esol Class | Soluble |
| Functional Groups | c/C=C/C(=O)O, cO, cOC |
| Compound Name | Diferulic acid |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 386.1 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 386.1 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 386.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.7789500571428576 |
| Inchi | InChI=1S/C20H18O8/c1-27-15-9-11(3-5-17(21)22)7-13(19(15)25)14-8-12(4-6-18(23)24)10-16(28-2)20(14)26/h3-10,25-26H,1-2H3,(H,21,22)(H,23,24)/b5-3+,6-4+ |
| Smiles | COC1=CC(=CC(=C1O)C2=C(C(=CC(=C2)/C=C/C(=O)O)OC)O)/C=C/C(=O)O |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 2.0 |
| Egan Rule | False |
| Np Classifier Superclass | Phenylpropanoids (C6-C3), Lignans |
- 1. Outgoing r'ship
FOUND_INto/from Prunus Avium (Plant) Rel Props:Reference:ISBN:9788185042145 - 2. Outgoing r'ship
FOUND_INto/from Prunus Cerasus (Plant) Rel Props:Reference:ISBN:9788185042145 - 3. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:cmaup_ingredients