Retrorsine
PubChem CID: 5281743
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | RETRORSINE, beta-Longilobine, 480-54-6, 12,18-Dihydroxysenecionan-11,16-dione, Retrorsin, XJ86XWL8IY, CHEBI:8822, cis-Retronecic acid ester of retronecine, CCRIS 4338, HSDB 3530, UNII-XJ86XWL8IY, NSC 107659, Retrorcine, 12,18-Dihydroxy-senecionan-11,16-dione, Senecionan-11,16-dione, 12,18-dihydroxy-, NSC-107659, Prestwick_562, Retrorsine (Standard), RETRORSINE [MI], Prestwick2_000637, Prestwick3_000637, RETRORSINE [HSDB], RETRORSINE [IARC], trans-15-Ethylidene-12beta-hydroxy-12alpha-hydroxymethyl-13beta-methylsenec-1-enine, (15Z)-12,18-dihydroxysenecionan-11,16-dione, BSPBio_000634, 3-Ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-hydroxymethyl-5-methyl(1,6)dioxacyclododeca(2,3,4-gh)pyrrolizidine-2,7-dione, MLS002153926, SCHEMBL133058, BPBio1_000698, CHEMBL496894, DTXSID6021242, Retrorsine, >=90% (HPLC), HY-N6638R, HMS1545M22, HMS1569P16, HMS2096P16, HMS2231J18, HY-N6638, Retrorsine 100 microg/mL in Water, AKOS024282552, CCG-208491, NCGC00142486-03, 1ST40320, MS-25432, SMR001233270, CS-0062871, G12795, SR-01000841220, SR-01000841220-3, BRD-K42142750-001-01-5, BRD-K42142750-001-04-9, Q27108154, (Z)-ethylidene-hydroxy-(hydroxymethyl)-methyl-[?]dione, (1,6)Dioxacyclododecino(2,3,4-gh)pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-(hydroxymethyl)-5-methyl-, (3Z,5R,6S,14aR,14bR)-, (1R,4Z,6R,7S,17R)-4-ethylidene-7-hydroxy-7-(hydroxymethyl)-6-methyl-2,9-dioxa-14-azatricyclo[9.5.1.0??,??]heptadec-11-ene-3,8-dione, (1R,4Z,6R,7S,17R)-4-ethylidene-7-hydroxy-7-(hydroxymethyl)-6-methyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione, (5R,6S,9a1R,14aR,Z)-3-ethylidene-6-hydroxy-6-(hydroxymethyl)-5-methyl-3,4,5,6,9,9a1,11,13,14,14a-decahydro-[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 96.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCCC(C)C(C)CC2CCC3CCC(CC1)C32 |
| Np Classifier Class | Pyrrolizidine alkaloids |
| Deep Smiles | C/C=C/C[C@@H]C)[C@]O)CO))C=O)OCC=CCN[C@H]5[C@H]OC/%15=O)))CC5 |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Macrolides and analogues |
| Scaffold Graph Node Level | CC1CCCC(O)OCC2CCN3CCC(OC1O)C23 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 627.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Uniprot Id | P46063, Q962Y6, Q96QE3, Q13951, P83916, Q9UBT6, P11308, Q9NUW8, P27695, n.a. |
| Iupac Name | (1R,4Z,6R,7S,17R)-4-ethylidene-7-hydroxy-7-(hydroxymethyl)-6-methyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadec-11-ene-3,8-dione |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Target Id | NPT47 |
| Xlogp | 0.6 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H25NO6 |
| Scaffold Graph Node Bond Level | C=C1CCCC(=O)OCC2=CCN3CCC(OC1=O)C23 |
| Prediction Swissadme | 1.0 |
| Inchi Key | BCJMNZRQJAVDLD-CQRYIUNCSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.6666666666666666 |
| Logs | -2.808 |
| Rotatable Bond Count | 1.0 |
| Logd | -0.114 |
| Synonyms | retrorsine |
| Esol Class | Soluble |
| Functional Groups | C/C=C(/C)C(=O)OC, CC=C(C)C, CN(C)C, CO, COC(C)=O |
| Compound Name | Retrorsine |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 351.168 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 351.168 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 351.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.324373800000001 |
| Inchi | InChI=1S/C18H25NO6/c1-3-12-8-11(2)18(23,10-20)17(22)24-9-13-4-6-19-7-5-14(15(13)19)25-16(12)21/h3-4,11,14-15,20,23H,5-10H2,1-2H3/b12-3-/t11-,14-,15-,18-/m1/s1 |
| Smiles | C/C=C\1/C[C@H]([C@@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)(CO)O)C |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Ornithine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Dysphania Ambrosioides (Plant) Rel Props:Source_db:npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Senecio Scandens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Senecio Vulgaris (Plant) Rel Props:Reference:ISBN:9788185042053; ISBN:9788185042114