Cucurbitacin F
PubChem CID: 5281320
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cucurbitacin F, 5939-57-1, UNII-X8WI6P1NLN, X8WI6P1NLN, CCRIS 7546, CUCURBITACINE F, (2S,3S,8S,9R,10R,13R,14S,16R,17R)-17-[(E,2R)-2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl]-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one, NSC 251680, CHEBI:3945, NSC-251680, 2,3,16,20,25-Pentahydroxy-9-methyl-19-norlanosta-5,23-diene-11,22-dione (2beta,3alpha,9beta,10alpha,16alpha,23E)-, 19-NORLANOSTA-5,23-DIENE-11,22-DIONE, 2,3,16,20,25-PENTAHYDROXY-9-METHYL-, (2.BETA.,3.ALPHA.,9.BETA.,10.ALPHA.,16.ALPHA.,23E)-, 19-Norlanosta-5,23-diene-11,22-dione, 2,3,16,20,25-pentahydroxy-9-methyl-, (2beta,3alpha,9beta,10alpha,16alpha,23E)-, (2S,3S,8S,9R,10R,13R,14S,16R,17R)-17-((E,2R)-2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl)-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta(a)phenanthren-11-one, CHEMBL488312, DTXSID301317374, LMST01010108, C08798, Q27106263 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 135.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CC2CCCC2C2CCC3CCCCC3C12 |
| Np Classifier Class | Cucurbitane triterpenoids |
| Deep Smiles | O[C@H]C[C@@H]C=CC[C@@H][C@@]6C)C=O)C[C@][C@@]6C)C[C@H][C@@H]5[C@]C=O)/C=C/CO)C)C)))))O)C)))O))))C))))))))C[C@@H]6O))C)C |
| Heavy Atom Count | 37.0 |
| Classyfire Class | Steroids and steroid derivatives |
| Scaffold Graph Node Level | OC1CC2CCCC2C2CCC3CCCCC3C12 |
| Classyfire Subclass | Cucurbitacins |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1060.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | (2S,3S,8S,9R,10R,13R,14S,16R,17R)-17-[(E,2R)-2,6-dihydroxy-6-methyl-3-oxohept-4-en-2-yl]-2,3,16-trihydroxy-4,4,9,13,14-pentamethyl-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 1.9 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C30H46O7 |
| Scaffold Graph Node Bond Level | O=C1CC2CCCC2C2CC=C3CCCCC3C12 |
| Prediction Swissadme | 0.0 |
| Inchi Key | AOHIGMQGPFTKQX-QZPKXHNASA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8 |
| Logs | -4.255 |
| Rotatable Bond Count | 4.0 |
| Logd | 2.65 |
| Synonyms | cucurbitacin f |
| Esol Class | Moderately soluble |
| Functional Groups | C/C=C/C(C)=O, CC(C)=O, CC=C(C)C, CO |
| Compound Name | Cucurbitacin F |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 518.324 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 518.324 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 518.7 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.014084200000002 |
| Inchi | InChI=1S/C30H46O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-12,17-20,23-24,31-32,35-37H,10,13-15H2,1-8H3/b12-11+/t17-,18+,19-,20+,23+,24-,27+,28-,29+,30+/m1/s1 |
| Smiles | C[C@@]12C[C@H]([C@@H]([C@]1(CC(=O)[C@@]3([C@H]2CC=C4[C@H]3C[C@@H]([C@H](C4(C)C)O)O)C)C)[C@](C)(C(=O)/C=C/C(C)(C)O)O)O |
| Nring | 4.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | False |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Elaeocarpus Floribundus (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Elaeocarpus Fuscoides (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Elaeocarpus Ganitrus (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Elaeocarpus Mastersii (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Elaeocarpus Munronii (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Elaeocarpus Oblongus (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Elaeocarpus Ratus (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Elaeocarpus Serratus (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Elaeocarpus Sphaericus (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Elaeocarpus Tuberculatus (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Picrorhiza Kurroa (Plant) Rel Props:Reference:https://doi.org/10.1093/database/bav075 - 12. Outgoing r'ship
FOUND_INto/from Trichosanthes Anaimalaienis (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Trichosanthes Anguina (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Trichosanthes Bracteata (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Trichosanthes Cordata (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Trichosanthes Cucumerina (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Trichosanthes Cucumeroides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Trichosanthes Dioica (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Trichosanthes Ichiana (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Trichosanthes Kirilowii (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Trichosanthes Laciniosa (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Trichosanthes Lepiniana (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Trichosanthes Lobata (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Trichosanthes Nervifolia (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Trichosanthes Palmata (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Trichosanthes Rosthornii (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Trichosanthes Tricuspidata (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Trichosanthes Wallichiana (Plant) Rel Props:Reference: