Citroxanthin
PubChem CID: 5281246
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Citroxanthin, Mutatochrome, 515-06-0, 5,8-Monoepoxy-beta-carotene, MO0US97U17, 4,4,7a-trimethyl-2-[(2E,4E,6E,8E,10E,12E,14E,16E)-6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran, MUTATOCHROME, ALL-TRANS-, 5,8-EPOXY-5,8-DIHYDRO-.BETA.,.BETA.-CAROTENE, .BETA.,.BETA.-CAROTENE, 5,8-EPOXY-5,8-DIHYDRO-, Flavacin, Flavacin?, 4,4,7a-trimethyl-2-((2E,4E,6E,8E,10E,12E,14E,16E)-6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl)-2,5,6,7-tetrahydro-1-benzofuran, beta-Carotene 5,8-epoxide, SCHEMBL39732, CHEBI:7037, LMPR01070277, 5,8-Epoxy-5,8-dihydro-b,b-carotene, C08605, 5,8-EPOXY-5,8-DIHYDRO-BETA,BETA-CAROTENE, BETA,BETA-CAROTENE, 5,8-EPOXY-5,8-DIHYDRO-, Q15425813, beta,beta-Carotene, 5,8-epoxy-5,8-dihydro-, (9cis)- |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 9.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C(CCCCCCCCC1CC2CCCCC2C1)CCCCCCCC1CCCCC1 |
| Np Classifier Class | Carotenoids (C40, β-β) |
| Deep Smiles | C/C=CC=CC=CC=CC=CCC=CCO5)C)CCCC6C)C)))))))))/C)))))/C))))))/C=C/C=C/C=C/C=CC)CCCC6C)C)))))))))C |
| Heavy Atom Count | 41.0 |
| Classyfire Class | Prenol lipids |
| Description | Mutatochrome, also known as citroxanthin, is a member of the class of compounds known as xanthophylls. Xanthophylls are carotenoids containing an oxygenated carotene backbone. Carotenes are characterized by the presence of two end-groups (mostly cyclohexene rings, but also cyclopentene rings or acyclic groups) linked by a long branched alkyl chain. Carotenes belonging form a subgroup of the carotenoids family. Xanthophylls arise by oxygenation of the carotene backbone. Thus, mutatochrome is considered to be an isoprenoid lipid molecule. Mutatochrome is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Mutatochrome can be found in a number of food items such as passion fruit, citrus, sweet orange, and pepper (c. frutescens), which makes mutatochrome a potential biomarker for the consumption of these food products. Mutatochrome (5,8-epoxy-β-carotene) is a carotenoid. It is the predominant carotenoid in the cap of the bolete mushroom Boletus luridus . |
| Scaffold Graph Node Level | C(CCCCCCCCC1CC2CCCCC2O1)CCCCCCCC1CCCCC1 |
| Classyfire Subclass | Tetraterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1260.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 4,4,7a-trimethyl-2-[(2E,4E,6E,8E,10E,12E,14E,16E)-6,11,15-trimethyl-17-(2,6,6-trimethylcyclohexen-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 12.5 |
| Superclass | Lipids and lipid-like molecules |
| Subclass | Tetraterpenoids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C40H56O |
| Scaffold Graph Node Bond Level | C(C=CC=CC=CC=CC1C=C2CCCCC2O1)=CC=CC=CC=CC1=CCCCC1 |
| Inchi Key | GFPJSSAOISEBQL-FZKBJVJCSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 9.0 |
| State | Solid |
| Synonyms | 5,8-Epoxy-5,8-dihydro-b,b-carotene, 5,8-Monoepoxy-beta-carotene, beta-Carotene 5,8-epoxide, Flavacin?, Mutatochrome, mutatochrome, mutatochrome (5,8-epoxy-5,8-dihydro-β,β-carotene) |
| Esol Class | Poorly soluble |
| Functional Groups | CC(C)=C(C)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(/C)C, CC=C(C)C, COC |
| Compound Name | Citroxanthin |
| Kingdom | Organic compounds |
| Exact Mass | 552.433 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 552.433 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 552.9 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 8.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C40H56O/c1-30(19-13-20-32(3)24-25-35-33(4)23-15-26-38(35,6)7)17-11-12-18-31(2)21-14-22-34(5)36-29-37-39(8,9)27-16-28-40(37,10)41-36/h11-14,17-22,24-25,29,36H,15-16,23,26-28H2,1-10H3/b12-11+,19-13+,21-14+,25-24+,30-17+,31-18+,32-20+,34-22+ |
| Smiles | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C2C=C3C(CCCC3(O2)C)(C)C)/C)/C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 8.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Xanthophylls |
| Np Classifier Superclass | Carotenoids (C40) |
- 1. Outgoing r'ship
FOUND_INto/from Carica Papaya (Plant) Rel Props:Reference:ISBN:9788171360536; ISBN:9788185042053 - 2. Outgoing r'ship
FOUND_INto/from Citrus Reticulata (Plant) Rel Props:Reference:ISBN:9770972795006 - 3. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Reference:ISBN:9788185042084 - 4. Outgoing r'ship
FOUND_INto/from Lycopersicon Esculentum (Plant) Rel Props:Reference:ISBN:9788172361150 - 5. Outgoing r'ship
FOUND_INto/from Lycopersicon Lycopersicum (Plant) Rel Props:Reference:ISBN:9788185042084 - 6. Outgoing r'ship
FOUND_INto/from Momordica Charantia (Plant) Rel Props:Source_db:fooddb_chem_all