Avenanthramide A
PubChem CID: 5281157
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Avenanthramide A, 108605-70-5, Avenanthramide BP, Avenanthramide 2P, G1I8LE060C, UNII-G1I8LE060C, Benzoic acid, 5-hydroxy-2-(((2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl)amino)-, 5-hydroxy-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid, DTXSID801316626, Benzoic acid, 5-hydroxy-2-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]-, (Z)-N-Coumaroyl-5-hydroxyanthranilic acid, 2-((4-hydroxycinnamoyl)amino)-5-hydroxybenzoate, 2-[(4-hydroxycinnamoyl)amino]-5-hydroxybenzoate, Avenalumin I, 5-hydroxy-2-(((E)-3-(4-hydroxyphenyl)prop-2-enoyl)amino)benzoic acid, 5-Hydroxy-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoic Acid, Avenanthramide 2p, Avenanthramide Bp, AVENANTHRAMIDEA, C08472, CHEBI:2939, SCHEMBL4670083, DTXCID501746464, Avenanthramide A, analytical standard, AKOS040750647, HY-114977, CS-0064722, G83417, 5-Hydroxy-N-(4-hydroxycinnamoyl)anthranilic acid, Q27105894, N-(4'-hydroxy-(e)-cinnamoyl)-5-hydroxyanthranilic acid, (E)-5-Hydroxy-2-(3-(4-hydroxyphenyl)acrylamido)benzoic acid, 5-Hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]benzoate, 5-hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid |
|---|---|
| Topological Polar Surface Area | 107.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 22.0 |
| Description | (z)-n-coumaroyl-5-hydroxyanthranilic acid is a member of the class of compounds known as avenanthramides. Avenanthramides are a group of phenolic alkaloids consisting of conjugate of three phenylpropanoids (ferulic, caffeic, or p-coumaric acid) and anthranilic acid (z)-n-coumaroyl-5-hydroxyanthranilic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). (z)-n-coumaroyl-5-hydroxyanthranilic acid can be found in cereals and cereal products and oat, which makes (z)-n-coumaroyl-5-hydroxyanthranilic acid a potential biomarker for the consumption of these food products. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 428.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-hydroxy-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
| Prediction Hob | 1.0 |
| Class | Cinnamic acids and derivatives |
| Xlogp | 2.6 |
| Superclass | Phenylpropanoids and polyketides |
| Subclass | Hydroxycinnamic acids and derivatives |
| Molecular Formula | C16H13NO5 |
| Prediction Swissadme | 0.0 |
| Inchi Key | QGUMNWHANDITDB-FPYGCLRLSA-N |
| Fcsp3 | 0.0 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Synonyms | Avenanthramide A (Collins), Avenanthramide A4 (Dimberg), N-[4'-Hydroxy-(E)cinnamoyl]-5-hydroxyanthranilic acid, 5-Hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]benzoate, 5-Hydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enamido]benzoic acid, (Z)-N-Coumaroyl-5-hydroxyanthranilate, 5-Hydroxy-N-(4-hydroxycinnamoyl)anthranilic acid, Avenalumin I, Avenanthramide a |
| Compound Name | Avenanthramide A |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 299.079 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 299.079 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 299.28 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Esol | -3.375684763636364 |
| Inchi | InChI=1S/C16H13NO5/c18-11-4-1-10(2-5-11)3-8-15(20)17-14-7-6-12(19)9-13(14)16(21)22/h1-9,18-19H,(H,17,20)(H,21,22)/b8-3+ |
| Smiles | C1=CC(=CC=C1/C=C/C(=O)NC2=C(C=C(C=C2)O)C(=O)O)O |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Avenanthramides |
- 1. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:cmaup_ingredients