Falcarindiol
PubChem CID: 5281148
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Falcarindiol, 225110-25-8, (+)-(3R,8S)-Falcarindiol, (3R,8S)-Falcarindiol, (3S,8S)-Falcarindiol, AC1NQY3Z, (3R,8S,9Z)-heptadeca-1,9-dien-4,6-diyne-3,8-diol, Falcalindiol, 55297-87-5, CHEMBL69018, Heptadeca-1,9-diene-4,6-diyne-3,8-diol, 1,9-Heptadecadiene-4,6-diyne-3,8-diol, 1,9-Heptadecadiene-4,6-diyne-3,8-diol, (3R,8S,9Z)-, SCHEMBL40935, EX-A8013E, DTXSID701030449, HY-N1976, BDBM50071370, LMFA05000658, s3292, AKOS032948569, FF23218, MS-23671, CS-0018296, C08449, G60922, Heptadeca-1,9(Z)-diene-4,6-diyne-3,8-diol, (8S,9Z)-heptadeca-1,9-dien-4,6-diyne-3,8-diol, Q5431681, (3R,8S,)-heptadeca-1,9-dien-4,6-diyne-3,8-diol, (3r,8s,9z)-heptadeca-1,9-dien-4,6-diyn-3,8-diol, (3R,8S,Z)-Heptadeca-1,9-dien-4,6-diyne-3,8-diol, (Z)-(3R,8S)-Heptadeca-1,9-diene-4,6-diyne-3,8-diol, (Z)-(3S,8S)-Heptadeca-1,9-diene-4,6-diyne-3,8-diol, (3R,8S,9Z)-1,9-Heptadecadiene-4,6-diyne-3,8-diol, (+)-(3R,8S)-Falcarindiol, (3R),(8S)-Falcarindiol |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Fatty alcohols |
| Deep Smiles | CCCCCCC/C=C[C@@H]C#CC#C[C@@H]C=C))O))))))O |
| Heavy Atom Count | 19.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 394.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Uniprot Id | Q9ES14, P33535, P32300, P41145, P18901, n.a., P23219, P34969, P18031, P37231 |
| Iupac Name | (3R,8S,9Z)-heptadeca-1,9-dien-4,6-diyne-3,8-diol |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Target Id | NPT272, NPT30, NPT1785, NPT99 |
| Xlogp | 4.4 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C17H24O2 |
| Prediction Swissadme | 1.0 |
| Inchi Key | QWCNQXNAFCBLLV-YWALDVPYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5294117647058824 |
| Logs | -4.123 |
| Rotatable Bond Count | 9.0 |
| Logd | 3.519 |
| Synonyms | falcarindiol |
| Esol Class | Soluble |
| Functional Groups | C/C=CC, C=CC, CC#CC#CC, CO |
| Compound Name | Falcarindiol |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 260.178 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 260.178 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 260.399 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.6857373999999994 |
| Inchi | InChI=1S/C17H24O2/c1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h4,10,14,16-19H,2-3,5-9H2,1H3/b14-10-/t16-,17+/m1/s1 |
| Smiles | CCCCCCC/C=C\[C@@H](C#CC#C[C@@H](C=C)O)O |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Anethum Graveolens (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/9556156 - 2. Outgoing r'ship
FOUND_INto/from Angelica Acutiloba (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Angelica Dahurica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Angelica Decursiva (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Angelica Furcijuga (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Angelica Gigas (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Angelica Keiskei (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Angelica Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Aralia Fargesii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Carum Carvi (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/9556156 - 11. Outgoing r'ship
FOUND_INto/from Cicuta Virosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Cnidium Officinale (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Coriandrum Sativum (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/9556156 - 14. Outgoing r'ship
FOUND_INto/from Crithmum Maritimum (Plant) Rel Props:Source_db:npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Daucus Sativus (Plant) Rel Props:Reference:ISBN:9788172362300 - 17. Outgoing r'ship
FOUND_INto/from Glehnia Littoralis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Hansenia Forbesii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Hansenia Weberbaueriana (Plant) Rel Props:Source_db:cmaup_ingredients - 20. Outgoing r'ship
FOUND_INto/from Ligusticum Sinense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Oplopanax Horridus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 22. Outgoing r'ship
FOUND_INto/from Ostericum Grosseserratum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Panax Ginseng (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 24. Outgoing r'ship
FOUND_INto/from Peucedanum Praeruptorum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 25. Outgoing r'ship
FOUND_INto/from Piscidia Piscipula (Plant) Rel Props:Source_db:npass_chem_all - 26. Outgoing r'ship
FOUND_INto/from Seseli Grandivittatum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all