Farnesal
PubChem CID: 5280598
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Farnesal, 19317-11-4, 502-67-0, (2E,6E)-Farnesal, (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienal, E,E-Farnesal, trans-farnesal, trans,trans-Farnesal, 2-trans,6-trans-Farnesal, (E,E)-3,7,11-Trimethyl-2,6,10-dodecatrienal, trans,trans-2,6-Farnesal, 3,7,11-trimethyl-2,6,10-dodecatrienal, 3,7,11-trimethyldodeca-2,6,10-trienal, 2,6,10-Dodecatrienal, 3,7,11-trimethyl-, Farnesal, (2E,6E)-, (2-trans,6-trans)-farnesal, (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienal, 2,6,10-Dodecatrienal, 3,7,11-trimethyl-, (E,E)-, (2-trans,6-trans)-3,7,11-trimethyldodeca-2,6,10-trienal, CHEBI:15894, G4E58106EW, 2,6,10-Dodecatrienal, 3,7,11-trimethyl-, (2E,6E)-, 3,7,11-Trimethyl-dodeca-2,6,10-trienal, Farnesal (Mixture of Isomers, Technical Grade), (e,e)-farnesal, UNII-G4E58106EW, UNII-R265G157TQ, farnesal, pract., EINECS 242-957-9, FARNESOL_met006, AI3-32959, 2-trans-6-trans-farnesal, CHEMBL3120646, CHEBI:24012, DTXSID60880981, R265G157TQ, MFCD00038089, AKOS024263035, Farnesal (Mixture of Isomers pound(c), LMPR0103010012, FEMA NO. 4019, (2E,6E)-, C03461, G86061, (2E,6E)-3,7,11-trimethyl-dodeca-2,6,10-trienal, (E,E)-3,7,11-Trimethyl-2,6,10-dodecatrienaldehyde, Q27098285, (2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-al, (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienal # |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Farnesane sesquiterpenoids |
| Deep Smiles | O=C/C=C/CC/C=C/CCC=CC)C)))))C)))))C |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Prenol lipids |
| Description | Farnesal, also known as (2e,6e)-3,7,11-trimethyl-2,6,10-dodecatrienal or 2-trans,6-trans-farnesal, is a member of the class of compounds known as sesquiterpenoids. Sesquiterpenoids are terpenes with three consecutive isoprene units. Thus, farnesal is considered to be an isoprenoid lipid molecule. Farnesal is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Farnesal is a floral and minty tasting compound and can be found in a number of food items such as bamboo shoots, dandelion, italian sweet red pepper, and chicory roots, which makes farnesal a potential biomarker for the consumption of these food products. |
| Classyfire Subclass | Sesquiterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 289.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q9UHG3 |
| Iupac Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienal |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 4.9 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Sesquiterpenoids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C15H24O |
| Prediction Swissadme | 0.0 |
| Inchi Key | YHRUHBBTQZKMEX-YFVJMOTDSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.5333333333333333 |
| Rotatable Bond Count | 7.0 |
| Synonyms | (2-trans,6-trans)-3,7,11-trimethyldodeca-2,6,10-trienal, (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienal, (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienal, (2E,6E)-Farnesal, (E,E)-3,7,11-Trimethyl-2,6,10-dodecatrienal, 2-trans,6-trans-Farnesal, 2-TRANS6-TRANS-FARNESAL, 2-transS6-trans-farnesal, 2,6-trans-trans-Farnesal, 2,6,10-Dodecatrienal, 3,7,11-trimethyl-, 2,6,10-Dodecatrienal, 3,7,11-trimethyl-, (2E,6E)-, 2,6,10-Dodecatrienal, 3,7,11-trimethyl-, (E,E)-, 2,6,10-Farnesatrien-1-al, 3,7,11-Trimethyl-2,6,10-dodecatrienal, 3,7,11-trimethyl-2,6,10-dodecatrienal (farnesal), 3,7,11-trimethyldodeca-2,6,10-trienal, E,E-Farnesal, Farnesal, Farnesal (e,e), Farnesal, trans,trans-, Farnesyl aldehyde, Trans-farnesal, Trans, trans-farnesal, trans,trans-2,6-Farnesal, trans,trans-Farnesal, (2-trans,6-trans)-3,7,11-Trimethyldodeca-2,6,10-trienal, (e,e)-3,7,11-Trimethyl-2,6,10-dodecatrienal, e,e-Farnesal, trans-Farnesal, (2e,6e)-farnesal, e-e-farnesal, farnesal, farnesal,(2e,6e) |
| Esol Class | Soluble |
| Functional Groups | C/C(C)=C/C=O, C/C=C(/C)C, CC=C(C)C |
| Compound Name | Farnesal |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 220.183 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 220.183 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 220.35 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 2.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -3.8249071999999997 |
| Inchi | InChI=1S/C15H24O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11+ |
| Smiles | CC(=CCC/C(=C/CC/C(=C/C=O)/C)/C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 2.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Sesquiterpenoids |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Aloysia Citriodora (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.895153 - 2. Outgoing r'ship
FOUND_INto/from Alpinia Galanga (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Arachis Hypogaea (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.961039 - 4. Outgoing r'ship
FOUND_INto/from Citrus Aurantium (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Citrus Maxima (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Citrus Medica (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1998.9700866 - 7. Outgoing r'ship
FOUND_INto/from Citrus Natsudaidai (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Citrus Trifoliata (Plant) Rel Props:Source_db:cmaup_ingredients - 10. Outgoing r'ship
FOUND_INto/from Corymbia Citriodora (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Cymbopogon Citratus (Plant) Rel Props:Source_db:fooddb_chem_all - 12. Outgoing r'ship
FOUND_INto/from Cymbopogon Martini (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2018.1512533 - 13. Outgoing r'ship
FOUND_INto/from Hedychium Coronarium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1993.9698190 - 14. Outgoing r'ship
FOUND_INto/from Juniperus Communis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1527 - 15. Outgoing r'ship
FOUND_INto/from Lonicera Japonica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Lycopersicon Esculentum (Plant) Rel Props:Source_db:fooddb_chem_all - 17. Outgoing r'ship
FOUND_INto/from Madhuca Longifolia (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2019.1667879 - 18. Outgoing r'ship
FOUND_INto/from Magnolia Biondii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Magnolia Denudata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Magnolia Grandiflora (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2012.10644108 - 21. Outgoing r'ship
FOUND_INto/from Magnolia Kobus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 22. Outgoing r'ship
FOUND_INto/from Magnolia Salicifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Magnolia Sprengeri (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 24. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2017.1321504 - 25. Outgoing r'ship
FOUND_INto/from Pogostemon Cablin (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.862077 - 26. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all