Dihydrofarnesol
PubChem CID: 5280341
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | DIHYDROFARNESOL, (+/-)-Dihydrofarnesol, 2,3-Dihydro-6-trans-farnesol, 37519-97-4, Dihydrofarnesol, (+/-)-, (+/-)DIHYDRAFARNESOL, FEMA No. 4031, (6E)-3,7,11-trimethyldodeca-6,10-dien-1-ol, 2,3-Dihydro-(E)-6-farnesol, 2,3-Dihydrofarnesol, 3,7,11-Trimethyl-6E,10-dodecadien-1-ol, 2U2PG80P22, 6,10-Dodecadien-1-ol, 3,7,11-trimethyl-, (E)-, 51411-24-6, 6,10-Dodecadien-1-ol, 3,7,11-trimethyl-, (6E)-, (E)-3,7,11-Trimethyldodeca-6,10-dien-1-ol, (e)-2,3-dihydrofarnesol, 3,7,11-Trimethyl-6,10-dodecadien-1-ol, 2,3-Dihydrofarnesol, UNII-2U2PG80P22, (+/-)-Dihydrofarnesol [FIFH], SCHEMBL509821, CHEBI:188055, LMFA05000145, 2,3-Dihydro-6-trans-farnesol (DL-), (+/-)-DIHYDROFARNESOL [FHFI], (E)-3,7,11-Trimethyl-6,10-dodecadien-1-ol, (6E)-3,7,11-Trimethyl-6,10-dodecadien-1-ol #, Q27255599, (+)-(6E)-3,7,11- trimethyl-6,10-dodecadien-1-ol, 6,10-Dodecadien-1-ol, 3,7,11-trimethyl-, (E)-(.+/-.)- |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Acyclic monoterpenoids, Farnesane sesquiterpenoids |
| Deep Smiles | OCCCCC/C=C/CCC=CC)C)))))C)))))C |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Prenol lipids |
| Classyfire Subclass | Sesquiterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 222.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (6E)-3,7,11-trimethyldodeca-6,10-dien-1-ol |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 5.1 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C15H28O |
| Inchi Key | OOOOFOPLSIWRAR-NTEUORMPSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 8.0 |
| Synonyms | (e)-2,3dihydrofarnesoi |
| Esol Class | Moderately soluble |
| Functional Groups | C/C=C(/C)C, CC=C(C)C, CO |
| Compound Name | Dihydrofarnesol |
| Exact Mass | 224.214 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 224.214 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 224.38 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H28O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,15-16H,5-6,8,10-12H2,1-4H3/b14-9+ |
| Smiles | CC(CC/C=C(\C)/CCC=C(C)C)CCO |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Sesquiterpenoids, Monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Abelmoschus Moschatus (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1999.9701181