Stigmast-5-en-3-yl acetate
PubChem CID: 521199
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Stigmast-5-en-3-yl acetate, Acetyl-beta-sitosterol, Sitosterol,.beta., acetate, Stigmast-5-en-3-yl acetate #, Stigmast-5-en-3-beta-yl acetate, Stigmast-5-en-3-ol, acetate (8CI), b-Sitosterol acetate, Acetyl-beta -sitosterol, beta -sitosterol acetate, beta -sitosteryl acetate, beta -stitosteryl acetate, beta -sitosterol, acetate, Sitosterol,beta , acetate, beta -Sitosterol 3-acetate, 3beta -Acetoxystigmast-5-ene, CHEMBL4752800, PBWOIPCULUXTNY-UHFFFAOYSA-N, Stigmast-5-en-3beta -yl acetate, Stigmast-5-en-3beta -ol, acetate, AKOS002141140, AKOS021599437, [17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate, Stigmast-5-en-3-ol, acetate, (3beta )-, Stigmast-5-en-3-ol, acetate, (3beta)- (9CI), b-Sitosterol acetate (contains Campesterol acetate), 1-(5-ETHYL-6-METHYLHEPTAN-2-YL)-9A,11A-DIMETHYL-1H,2H,3H,3AH,3BH,4H,6H,7H,8H,9H,9AH,9BH,10H,11H,11AH-CYCLOPENTA[A]PHENANTHREN-7-YL ACETATE |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCC1C3CCCC3CCC21 |
| Np Classifier Class | Cholestane steroids, Stigmastane steroids |
| Deep Smiles | CCCCC)C))CCCCCCCC5C)CCCC6CC=CC6C)CCCC6)OC=O)C)))))))))))))))))))C |
| Heavy Atom Count | 33.0 |
| Classyfire Class | Prenol lipids |
| Description | Constituent of pods of kiker (Acacia leucophloea). beta-Sitosterol acetate is found in pulses. |
| Scaffold Graph Node Level | C1CCC2C(C1)CCC1C3CCCC3CCC21 |
| Classyfire Subclass | Triterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 737.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | n.a. |
| Iupac Name | [17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Class | Prenol lipids |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 9.9 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Triterpenoids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C31H52O2 |
| Scaffold Graph Node Bond Level | C1=C2CCCCC2C2CCC3CCCC3C2C1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | PBWOIPCULUXTNY-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.9032258064516128 |
| Logs | -7.183 |
| Rotatable Bond Count | 8.0 |
| State | Solid |
| Logd | 6.401 |
| Synonyms | &beta, -Sitosterol 3-acetate, &beta, -sitosterol acetate, &beta, -sitosterol, acetate, &beta, -sitosteryl acetate, &beta, -stitosteryl acetate, 3&beta, -Acetoxystigmast-5-ene, 3beta -Acetoxystigmast-5-ene, 3beta-Acetoxystigmast-5-ene, Acetyl-&beta, -sitosterol, Acetyl-beta -sitosterol, Acetyl-beta-sitosterol, b-Sitosterol acetate, beta -Sitosterol 3-acetate, beta -Sitosterol acetate, beta -Sitosterol, acetate, beta -Sitosteryl acetate, beta -Stitosteryl acetate, beta-Sitosterol 3-acetate, Beta-sitosterol acetate, Beta-sitosteryl acetate, Sitosterol acetate, Sitosterol,&beta, , acetate, Sitosterol,beta , acetate, Sitosterol,beta, acetate, Sitosteryl acetate, Stigmast-5-en-3-beta-yl acetate, Stigmast-5-en-3-ol, acetate, Stigmast-5-en-3-ol, acetate (8CI), Stigmast-5-en-3-ol, acetate, (3&beta, )-, Stigmast-5-en-3-ol, acetate, (3beta)- (9CI), Stigmast-5-en-3-yl acetate, Stigmast-5-en-3&beta, -ol, acetate, Stigmast-5-en-3&beta, -yl acetate, Stigmast-5-en-3beta -ol, acetate, Stigmast-5-en-3beta -yl acetate, Stigmast-5-en-3beta-ol, acetate, Stigmast-5-en-3beta-yl acetate, b-Sitosterol acetic acid, beta-Sitosterol acetic acid, Β-sitosterol acetate, Β-sitosterol acetic acid, beta-Sitosteryl acetate, Stigmast-5-en-3-ol, acetate (8ci), Stigmast-5-en-3-ol, acetate, (3beta)- (9ci), 14-(5-Ethyl-6-methylheptan-2-yl)-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-5-yl acetic acid, beta sitosterol acetate, beta-sitosterol acetate, sitosterol acetate, beta-, sitosterol acetate,beta-, β-sitosterol acetate |
| Esol Class | Poorly soluble |
| Functional Groups | CC=C(C)C, COC(C)=O |
| Compound Name | Stigmast-5-en-3-yl acetate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 456.397 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 456.397 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 456.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 9.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -8.387181000000002 |
| Inchi | InChI=1S/C31H52O2/c1-8-23(20(2)3)10-9-21(4)27-13-14-28-26-12-11-24-19-25(33-22(5)32)15-17-30(24,6)29(26)16-18-31(27,28)7/h11,20-21,23,25-29H,8-10,12-19H2,1-7H3 |
| Smiles | CCC(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C)C)C)C(C)C |
| Nring | 4.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Triterpenoids |
| Np Classifier Superclass | Steroids |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Leucophloea (Plant) Rel Props:Reference:ISBN:9788185042145 - 2. Outgoing r'ship
FOUND_INto/from Acalypha Indica (Plant) Rel Props:Reference:ISBN:9788172360818 - 3. Outgoing r'ship
FOUND_INto/from Aloysia Citriodora (Plant) Rel Props:Reference:ISBN:9788172360481; ISBN:9788185042084 - 4. Outgoing r'ship
FOUND_INto/from Althaea Officinalis (Plant) Rel Props:Reference:ISBN:9788185042114 - 5. Outgoing r'ship
FOUND_INto/from Benincasa Hispida (Plant) Rel Props:Reference:ISBN:9780387706375; ISBN:9788185042145 - 6. Outgoing r'ship
FOUND_INto/from Callicarpa Arborea (Plant) Rel Props:Reference:ISBN:9788185042084 - 7. Outgoing r'ship
FOUND_INto/from Crateva Nurvala (Plant) Rel Props:Reference:ISBN:9788172362133 - 8. Outgoing r'ship
FOUND_INto/from Crateva Religiosa (Plant) Rel Props:Reference:ISBN:9788172362133 - 9. Outgoing r'ship
FOUND_INto/from Cynomorium Songaricum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Dioscorea Japonica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Dioscorea Opposita (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Dioscorea Polystachya (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Echinops Echinatus (Plant) Rel Props:Reference:ISBN:9788172362300 - 14. Outgoing r'ship
FOUND_INto/from Elsholtzia Ciliata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Ginkgo Biloba (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Lasia Spinosa (Plant) Rel Props:Reference:ISBN:9770972795006 - 17. Outgoing r'ship
FOUND_INto/from Melastoma Malabathricum (Plant) Rel Props:Reference:ISBN:9770972795006 - 18. Outgoing r'ship
FOUND_INto/from Mosla Chinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Nicotiana Tabacum (Plant) Rel Props:Reference:ISBN:9788172361150 - 20. Outgoing r'ship
FOUND_INto/from Robinia Pseudoacacia (Plant) Rel Props:Reference:ISBN:9788185042084 - 21. Outgoing r'ship
FOUND_INto/from Tradescantia Virginiana (Plant) Rel Props:Reference:ISBN:9788185042138 - 22. Outgoing r'ship
FOUND_INto/from Vitex Negundo (Plant) Rel Props:Reference:ISBN:9788171360536; ISBN:9788185042114 - 23. Outgoing r'ship
FOUND_INto/from Ziziphus Jujuba (Plant) Rel Props:Reference:ISBN:9788185042084