C.I. Natural Red 20
PubChem CID: 5208
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 54952-43-1, SHIKALKIN, C.I. Natural Red 20, (+-)-Shikonin, (+/-)-Alkannin, (+/-)-Shikonin, 5,8-dihydroxy-2-(1-hydroxy-4-methylpent-3-enyl)naphthalene-1,4-dione, ARNEBIN-4, (Rac)-Shikonin, Anchusin, Shikonine, 23444-65-7, NSC94524, (+)-Shikonin, MFCD00016668, NSC252844, NSC407295, 5,8-DIHYDROXY-2-(1-HYDROXY-4-METHYLPENT-3-EN-1-YL)NAPHTHALENE-1,4-DIONE, C.I. 75530, 5,8-Dihydroxy-6-(1-hydroxy-4-methylpent-3-en-1-yl)naphthalene-1,4-dione, 1,4-Naphthalenedione, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)- (9CI), 11019-15-1, (+-)-Alkannin, C.I. 75535, C.I. 75535, Isoarnebin 4, C.I. Natural Red 20 (VAN), 1, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, (S)-, 1, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, (-)-, 1, 5,8-dihydroxy-6-(1-hydroxy-4-methyl-3-pentenyl)-, (-)-, NSC-252844, natural red 20, Shikonin (7b), (+-)-Shikalkin, NSC 291845, ALKANNIN, 1-, KBioGR_000610, KBioSS_000610, CHEMBL29285, SCHEMBL3182028, Shikonin, >=98% (HPLC), SCHEMBL14305203, KBio2_000610, KBio2_003178, KBio2_005746, KBio3_001079, KBio3_001080, NEZONWMXZKDMKF-UHFFFAOYSA-, CHEBI:174748, BDBM178090, Bio2_000475, Bio2_000955, HMS1362P11, BCP29329, BCP34282, ECA95243, HY-N6004, NSC291845, 1,4-Naphthalenedione, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-pent-3-enyl)naphthalene-1,4-dione, AKOS016034343, NSC-291845, NSC-407295, IDI1_002230, QTL1_000075, SMP2_000188, 85251-58-7, DA-67567, LS-14485, NCI60_002031, DB-082640, CS-0032051, H1780, NS00018361, NS00123717, (-)-Shikonin, C.I. 75535, Isoarnebin 4, 1, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, 1, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, (R)-, 1, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, (+)-, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-1,4-naphthoquinone, (+/-)-5,8-Dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-1,4-naphthoquinone, InChI=1/C16H16O5/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21/h3,5-7,10,17-19H,4H2,1-2H3 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 94.8 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCC(C)C2CCCCC12 |
| Np Classifier Class | Naphthoquinones |
| Deep Smiles | CC=CCCC=CC=O)ccC6=O))cO)ccc6O))))))))))O))))C |
| Heavy Atom Count | 21.0 |
| Classyfire Class | Naphthalenes |
| Description | Red dye component of alkanet root extract used for colouring sausage casings, margarine, confectionery and wine. This extract, formerly FEMA 2016, has been removed from the FEMA GRAS list. Not permitted in Germany. Japan approved. |
| Scaffold Graph Node Level | OC1CCC(O)C2CCCCC12 |
| Classyfire Subclass | Naphthoquinones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 501.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5,8-dihydroxy-2-(1-hydroxy-4-methylpent-3-enyl)naphthalene-1,4-dione |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 3.0 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C16H16O5 |
| Scaffold Graph Node Bond Level | O=C1C=CC(=O)c2ccccc21 |
| Prediction Swissadme | 0.0 |
| Inchi Key | NEZONWMXZKDMKF-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.25 |
| Logs | -3.46 |
| Rotatable Bond Count | 3.0 |
| Logd | 2.936 |
| Synonyms | Alkanet extract, Alkanet extract (van), Alkanna red, Alkanna red (van), Alkannin, Alkannin (van), Anchusa acid, Anchusa acid (van), Anchusin, Anchusin (van), C.I. 75530, C.I. Natural red 20, C.I. Natural Red 20 (VAN), shikalkin |
| Esol Class | Soluble |
| Functional Groups | CC1=CC(=O)ccC1=O, CC=C(C)C, CO, cO |
| Compound Name | C.I. Natural Red 20 |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 288.1 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 288.1 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 288.29 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.505682371428571 |
| Inchi | InChI=1S/C16H16O5/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21/h3,5-7,10,17-19H,4H2,1-2H3 |
| Smiles | CC(=CCC(C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)O)C |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Naphthalenes |
- 1. Outgoing r'ship
FOUND_INto/from Arnebia Euchroma (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Arnebia Guttata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Arnebia Hispidissima (Plant) Rel Props:Reference:ISBN:9788185042114 - 4. Outgoing r'ship
FOUND_INto/from Lithospermum Erythrorhizon (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Lithospermum Officinale (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all