2-Carboxyarabinitol
PubChem CID: 5165850
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-carboxyarabinitol, 2,3,4,5-tetrahydroxy-2-(hydroxymethyl)pentanoic acid, SCHEMBL21313126 |
|---|---|
| Topological Polar Surface Area | 138.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | XONDRGRALZTVKD-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| Synonyms | 2-C-(Hydroxymethyl)ribonic acid, 2-Carboxyarabinitol, Hamamelonic acid, 2,3,4,5-Tetrahydroxy-2-(hydroxymethyl)pentanoate |
| Heavy Atom Count | 13.0 |
| Compound Name | 2-Carboxyarabinitol |
| Kingdom | Organic compounds |
| Description | 2-carboxyarabinitol is a member of the class of compounds known as hydroxy fatty acids. Hydroxy fatty acids are fatty acids in which the chain bears a hydroxyl group. 2-carboxyarabinitol is soluble (in water) and a weakly acidic compound (based on its pKa). 2-carboxyarabinitol can be found in a number of food items such as tarragon, dandelion, ginkgo nuts, and spinach, which makes 2-carboxyarabinitol a potential biomarker for the consumption of these food products. |
| Exact Mass | 196.058 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 196.058 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 182.0 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 196.16 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,3,4,5-tetrahydroxy-2-(hydroxymethyl)pentanoic acid |
| Total Atom Stereocenter Count | 3.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Fatty Acyls |
| Inchi | InChI=1S/C6H12O7/c7-1-3(9)4(10)6(13,2-8)5(11)12/h3-4,7-10,13H,1-2H2,(H,11,12) |
| Smiles | C(C(C(C(CO)(C(=O)O)O)O)O)O |
| Xlogp | -3.6 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Fatty acids and conjugates |
| Taxonomy Direct Parent | Hydroxy fatty acids |
| Molecular Formula | C6H12O7 |
- 1. Outgoing r'ship
FOUND_INto/from Artemisia Dracunculus (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Citrus Limon (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Ginkgo Biloba (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Hordeum Vulgare (Plant) Rel Props:Source_db:fooddb_chem_all - 7. Outgoing r'ship
FOUND_INto/from Mentha Spicata (Plant) Rel Props:Source_db:fooddb_chem_all - 8. Outgoing r'ship
FOUND_INto/from Phaseolus Vulgaris (Plant) Rel Props:Source_db:fooddb_chem_all - 9. Outgoing r'ship
FOUND_INto/from Spinacia Oleracea (Plant) Rel Props:Source_db:fooddb_chem_all - 10. Outgoing r'ship
FOUND_INto/from Taraxacum Officinale (Plant) Rel Props:Source_db:fooddb_chem_all - 11. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all