2-(Hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxane-3,4,5-triol
PubChem CID: 4961358
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxane-3,4,5-triol, Hydroxyphenylethanol + Pen, Oprea1_438647, SCHEMBL26230939, DTXSID30860073, CHEBI:181593, HMS3331M02, HMS3656K15, AKOS037643374, 2-(4-Hydroxyphenyl)ethyl hexopyranoside, AS-15725, SY067815, Salidroside, from Rhodiola Crenulata extract, 2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]tetrahydropyran-3,4,5-triol |
|---|---|
| Topological Polar Surface Area | 120.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 21.0 |
| Description | Salidroside is a member of the class of compounds known as O-glycosyl compounds. O-glycosyl compounds are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. Salidroside is soluble (in water) and a very weakly acidic compound (based on its pKa). Salidroside can be found in olive, which makes salidroside a potential biomarker for the consumption of this food product. Salidroside (Rhodioloside) is a glucoside of tyrosol found in the plant Rhodiola rosea. It is thought to be one of the compounds responsible for the antidepressant and anxiolytic actions of this plant, along with rosavin. Salidroside may be more active than rosavin, even though many commercially marketed Rhodiola rosea extracts are standardised for rosavin content rather than salidroside . |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 306.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxane-3,4,5-triol |
| Nih Violation | False |
| Class | Organooxygen compounds |
| Xlogp | -0.6 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Molecular Formula | C14H20O7 |
| Inchi Key | ILRCGYURZSFMEG-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| Synonyms | 2-(4-Hydroxyphenyl)ethyl beta-D-glucopyranoside, beta-D-Glucopyranoside, 2-(4-hydroxyphenyl)ethyl, Glucopyranoside, p-hydroxyphenethyl, Rhodioloside, Rhodosin, Salidroside, Sceptroside |
| Compound Name | 2-(Hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxane-3,4,5-triol |
| Kingdom | Organic compounds |
| Exact Mass | 300.121 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 300.121 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 300.3 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Inchi | InChI=1S/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2 |
| Smiles | C1=CC(=CC=C1CCOC2C(C(C(C(O2)CO)O)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | O-glycosyl compounds |
- 1. Outgoing r'ship
FOUND_INto/from Olea Europaea (Plant) Rel Props:Source_db:fooddb_chem_all