Epicatechin 3-O-(4-O-methylgallate)
PubChem CID: 467297
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Epicatechin 3-O-(4-O-methylgallate), 108907-44-4, (-)-ECG-4''-O-ME, [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,5-dihydroxy-4-methoxybenzoate, CHEMBL159433, Epicatechin 3-O-(4-methylgallate), CHEBI:176148, DTXSID001292305, BDBM50296237, LMPK12020094, Epicatechin-3-O-(4-O-methyl)gallate, (2R,3R)-2-(3,4-Dihydroxyphenyl)-5,7-dihydroxychroman-3-yl 3,5-dihydroxy-4-methoxybenzoate, 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxychroman-3-yl 3,5-dihydroxy-4-methoxybenzoate, [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-chroman-3-yl] 3,5-dihydroxy-4-methoxy-benzoate, 3,5-Dihydroxy-4-methoxy-benzoic acid (2R,3R)-2-(3,4-dihydroxy-phenyl)-5,7-dihydroxy-chroman-3-yl ester |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 166.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC(CC1CC2CCCCC2CC1C1CCCCC1)C1CCCCC1 |
| Np Classifier Class | Flavan-3-ols |
| Deep Smiles | COccO)cccc6O)))C=O)O[C@@H]CccO)cccc6O[C@@H]%10cccccc6)O))O)))))))))O |
| Heavy Atom Count | 33.0 |
| Classyfire Class | Flavonoids |
| Description | Epicatechin 3-(4-methylgallate) is a member of the class of compounds known as catechin gallates. Catechin gallates are organic compounds containing a gallate moiety glycosidically linked to a catechin. Thus, epicatechin 3-(4-methylgallate) is considered to be a flavonoid lipid molecule. Epicatechin 3-(4-methylgallate) is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Epicatechin 3-(4-methylgallate) can be found in tea, which makes epicatechin 3-(4-methylgallate) a potential biomarker for the consumption of this food product. |
| Scaffold Graph Node Level | OC(OC1CC2CCCCC2OC1C1CCCCC1)C1CCCCC1 |
| Classyfire Subclass | Flavans |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 664.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,5-dihydroxy-4-methoxybenzoate |
| Class | Flavonoids |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 1.9 |
| Superclass | Phenylpropanoids and polyketides |
| Subclass | Flavans |
| Gsk 4 400 Rule | False |
| Molecular Formula | C23H20O10 |
| Scaffold Graph Node Bond Level | O=C(OC1Cc2ccccc2OC1c1ccccc1)c1ccccc1 |
| Inchi Key | BXDRTHBTGNNTEW-NHCUHLMSSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 5.0 |
| Synonyms | Epicatechin 3-O-(4-methylgallic acid), 3-O-(4-Methylgalloyl)epicatechin, Epicatechin 3-O-(4-O-methylgallate), Epicatechin 3-O-(4-O-methylgallic acid), (-)-epicatechin-3-o-(4-o-methyl)-gallate |
| Esol Class | Soluble |
| Functional Groups | cC(=O)OC, cO, cOC |
| Compound Name | Epicatechin 3-O-(4-O-methylgallate) |
| Kingdom | Organic compounds |
| Exact Mass | 456.106 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 456.106 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 456.4 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C23H20O10/c1-31-22-17(28)5-11(6-18(22)29)23(30)33-20-9-13-15(26)7-12(24)8-19(13)32-21(20)10-2-3-14(25)16(27)4-10/h2-8,20-21,24-29H,9H2,1H3/t20-,21-/m1/s1 |
| Smiles | COC1=C(C=C(C=C1O)C(=O)O[C@@H]2CC3=C(C=C(C=C3O[C@@H]2C4=CC(=C(C=C4)O)O)O)O)O |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Catechin gallates |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 2. Outgoing r'ship
FOUND_INto/from Punica Granatum (Plant) Rel Props:Source_db:fooddb_chem_all