Gentiotriose
PubChem CID: 4632877
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Gentiotriose, Isomaltotriose, 3371-50-4, 6-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol, 1,6-?-D-Mannotriose, SCHEMBL12557980, SCHEMBL26068663, AKOS037515143, OM10121, LS-14680, NS00048535, ?-D-Man-(1-6)-?-D-Man-(1-6)-D-Man, 6-({[3,4,5-trihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-2-yl]oxy}methyl)oxane-2,3,4,5-tetrol |
|---|---|
| Topological Polar Surface Area | 269.0 |
| Hydrogen Bond Donor Count | 11.0 |
| Inchi Key | FBJQEBRMDXPWNX-UHFFFAOYSA-N |
| Rotatable Bond Count | 7.0 |
| Synonyms | D-Gal alpha 1->6D-Gal alpha 1->6D-Glucose, D-Gal-alpha1->6D-Gal-alpha1->6D-Glucose, Manninotriose, Mnt, Gentiotriose, 8CI, 6-a-Isomaltosyl-D-glucose, Isomaltotriose, O-a-D-Glucopyranosyl-(1->6)-O-a-D-glucopyranosyl-(1->6)-D-glucose, 9CI |
| Heavy Atom Count | 34.0 |
| Compound Name | Gentiotriose |
| Description | Found free in cocoa beans, hazelnuts and in various plant mannans. Selectively utilised by bifidobacteria in the intestine but hardly utilised by other microorganisms. Increases faecal bifidobacteria and decreases Clostridia. Manninotriose is found in many foods, some of which are cocoa and cocoa products, nuts, cocoa bean, and potato. |
| Exact Mass | 504.169 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 504.169 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 641.0 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 504.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-[[3,4,5-trihydroxy-6-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| Total Atom Stereocenter Count | 15.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C18H32O16/c19-1-4-7(20)11(24)14(27)17(33-4)31-3-6-9(22)12(25)15(28)18(34-6)30-2-5-8(21)10(23)13(26)16(29)32-5/h4-29H,1-3H2 |
| Smiles | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OCC3C(C(C(C(O3)O)O)O)O)O)O)O)O)O)O)O |
| Xlogp | -6.9 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C18H32O16 |
- 1. Outgoing r'ship
FOUND_INto/from Corylus Avellana (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Solanum Tuberosum (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Theobroma Cacao (Plant) Rel Props:Source_db:fooddb_chem_all