Methylenecyclopropylglycine
PubChem CID: 4479247
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | CPD-9757, MCPG, 2-amino-2-(2-methylenecyclopropyl)acetic acid, a-Amino-2-methylenecyclopropaneacetic Acid, AC1NAMB5, 2-amino-2-(2-methylidenecyclopropyl)acetic acid, SureCN1062833, 2-(Methylencyclopropyl)-glycin, SCHEMBL1062833, DTXCID30102329, CHEBI:165857, alpha-(Methylenecyclopropyl)glycine, CAA51707, AKOS006361483, C08292, (S)-2-AMINO-2-(2-METHYLENECYCLOPROPYL)ACETIC ACID, a-(Methylenecyclopropyl)glycine (Mixture of Diastereomers), 2-Amino-2-(2-methylenecyclopropyl)acetic acid, mixture of diastereomers |
|---|---|
| Topological Polar Surface Area | 63.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 9.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 164.0 |
| Database Name | cmaup_ingredients;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-2-(2-methylidenecyclopropyl)acetic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Xlogp | -2.8 |
| Is Pains | False |
| Molecular Formula | C6H9NO2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | MPIZVHPMGFWKMJ-UHFFFAOYSA-N |
| Fcsp3 | 0.5 |
| Logs | -1.629 |
| Rotatable Bond Count | 2.0 |
| Logd | -0.176 |
| Compound Name | Methylenecyclopropylglycine |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 127.063 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 127.063 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 127.14 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 1.2740134000000003 |
| Inchi | InChI=1S/C6H9NO2/c1-3-2-4(3)5(7)6(8)9/h4-5H,1-2,7H2,(H,8,9) |
| Smiles | C=C1CC1C(C(=O)O)N |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Litchi Chinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all