b-D-Fructofuranosyl O-a-D-galactopyranosyl-(1->2)-a-D-glucopyranoside, 9CI
PubChem CID: 4479106
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | b-D-Fructofuranosyl O-a-D-galactopyranosyl-(1->2)-a-D-glucopyranoside, 9CI |
|---|---|
| Topological Polar Surface Area | 269.0 |
| Hydrogen Bond Donor Count | 11.0 |
| Inchi Key | LNRUEZIDUKQGRH-UHFFFAOYSA-N |
| Rotatable Bond Count | 8.0 |
| Synonyms | b-D-Fructofuranosyl O-a-D-galactopyranosyl-(1->2)-a-D-glucopyranoside, 9CI, b-D-Fructofuranosyl O-a-D-galactopyranosyl-(1->2)-a-D-glucopyranoside, 9ci |
| Heavy Atom Count | 34.0 |
| Compound Name | b-D-Fructofuranosyl O-a-D-galactopyranosyl-(1->2)-a-D-glucopyranoside, 9CI |
| Kingdom | Organic compounds |
| Description | Isolated from roots of Angelica archangelica (angelica) and other subspecies in the Umbelliferae. Umbelliferose is found in many foods, some of which are carrot, green vegetables, wild carrot, and fats and oils. |
| Exact Mass | 504.169 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 504.169 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 655.0 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 504.4 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[2-[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Total Atom Stereocenter Count | 14.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Organooxygen compounds |
| Inchi | InChI=1S/C18H32O16/c19-1-5-8(23)11(26)13(28)16(30-5)32-14-12(27)9(24)6(2-20)31-17(14)34-18(4-22)15(29)10(25)7(3-21)33-18/h5-17,19-29H,1-4H2 |
| Smiles | C(C1C(C(C(C(O1)OC2C(C(C(OC2OC3(C(C(C(O3)CO)O)O)CO)CO)O)O)O)O)O)O |
| Xlogp | -5.3 |
| Superclass | Organic oxygen compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Taxonomy Direct Parent | O-glycosyl compounds |
| Molecular Formula | C18H32O16 |
- 1. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:fooddb_chem_all