gamma-Hydroxyarginine
PubChem CID: 4473082
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | gamma-Hydroxyarginine, 2524-31-4, 2-amino-5-guanidino-4-hydroxypentanoic acid, CHEBI:47829, 2-amino-4-hydroxy-5-guanidopentanoic acid, 2-amino-5-{[amino(imino)methyl]amino}-4-hydroxypentanoic acid, 2-amino-5-((amino(imino)methyl)amino)-4-hydroxypentanoic acid, 4-Hydroxyarginine, 9CI, L-erythro-4-Hydroxyarginine, SCHEMBL1478033, 2-amino-5-guanidino-4-hydroxypentanoicacid, Q27120813 |
|---|---|
| Topological Polar Surface Area | 148.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 13.0 |
| Description | Occurs in the sea-cucumber (Polycheira rufescens) and in lentil seeds (Lens culinaris). L-erythro-4-Hydroxyarginine is found in pulses. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 202.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-5-(diaminomethylideneamino)-4-hydroxypentanoic acid |
| Prediction Hob | 1.0 |
| Class | Fatty Acyls |
| Xlogp | -5.2 |
| Superclass | Lipids and lipid-like molecules |
| Subclass | Fatty acids and conjugates |
| Molecular Formula | C6H14N4O3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | OPCBKDJCJYBGTQ-UHFFFAOYSA-N |
| Fcsp3 | 0.6666666666666666 |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Synonyms | 4-hydroxy-L-arginine, 4-Hydroxyarginine, 4-Hydroxyarginine, 9ci, 4-Hydroxyarginine, 9CI, L-erythro-form, gamma-Hydroxy-L-arginine, Gamma-hydroxyarginine, 2-Amino-4-hydroxy-5-guanidopentanoic acid, 2-Amino-5-{[amino(imino)methyl]amino}-4-hydroxypentanoic acid, 2-Amino-4-hydroxy-5-guanidopentanoate, 2-Amino-5-{[amino(imino)methyl]amino}-4-hydroxypentanoate, 2-amino-5-(diaminomethylideneamino)-4-Hydroxypentanoate, 4-Hydroxy-L-arginine, gamma-Hydroxyarginine, L-erythro-Form, g-Hydroxyarginine, Γ-hydroxyarginine, gamma-Hydroxyarginine, (L)-isomer |
| Substituent Name | Hydroxy fatty acid, Alpha-amino acid or derivatives, Alpha-amino acid, Short-chain hydroxy acid, Amino fatty acid, 1,3-aminoalcohol, Secondary alcohol, Guanidine, Carboximidamide, Monocarboxylic acid or derivatives, Carboxylic acid, Carboxylic acid derivative, Hydrocarbon derivative, Primary amine, Organooxygen compound, Organonitrogen compound, Primary aliphatic amine, Imine, Carbonyl group, Amine, Alcohol, Aliphatic acyclic compound |
| Compound Name | gamma-Hydroxyarginine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 190.107 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 190.107 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 190.2 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 2.4007414000000002 |
| Inchi | InChI=1S/C6H14N4O3/c7-4(5(12)13)1-3(11)2-10-6(8)9/h3-4,11H,1-2,7H2,(H,12,13)(H4,8,9,10) |
| Smiles | C(C(CN=C(N)N)O)C(C(=O)O)N |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Alpha amino acids |
- 1. Outgoing r'ship
FOUND_INto/from Michelia Yunnanensis (Plant) Rel Props:Source_db:npass_chem_all