alpha-L-arabinofuranose
PubChem CID: 445935
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ALPHA-L-ARABINOFURANOSE, 38029-69-5, R0L7IU6KYJ, UNII-R0L7IU6KYJ, CHEBI:28772, (2R,3R,4R,5S)-5-(hydroxymethyl)oxolane-2,3,4-triol, Alpha-L-arabinofuranose(9ci), DTXSID30332205, Epitope ID:136907, SCHEMBL78753, .ALPHA.-L-ARABINOFURANOSE, DTXCID40283299, DB03142, NS00069056, AF1DBBD3-29AC-464F-89DC-BBED6390D5FE, Q27094086, WURCS=2.0/1,1,0/(a211h-1a_1-4)/1/, (2R,3R,4R,5S)-5-(Hydroxymethyl)tetrahydrofuran-2,3,4-triol |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 90.2 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCCC1 |
| Np Classifier Class | Disaccharides, Monosaccharides |
| Deep Smiles | OC[C@@H]O[C@H][C@@H][C@H]5O))O))O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Organooxygen compounds |
| Description | Alpha-l-arabinose is a member of the class of compounds known as pentoses. Pentoses are monosaccharides in which the carbohydrate moiety contains five carbon atoms. Alpha-l-arabinose is very soluble (in water) and a very weakly acidic compound (based on its pKa). Alpha-l-arabinose can be found in a number of food items such as cloudberry, amaranth, red beetroot, and white mustard, which makes alpha-l-arabinose a potential biomarker for the consumption of these food products. |
| Scaffold Graph Node Level | C1CCOC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 117.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (2R,3R,4R,5S)-5-(hydroxymethyl)oxolane-2,3,4-triol |
| Nih Violation | False |
| Class | Organooxygen compounds |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -2.0 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H10O5 |
| Scaffold Graph Node Bond Level | C1CCOC1 |
| Inchi Key | HMFHBZSHGGEWLO-QMKXCQHVSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | WURCS=2.0/1,1,0/[a211h-1a_1-4]/1/, a-L-Arabinose, Α-L-arabinose, alpha-L-Arabinose, alpha-l-arabinofuranosyl |
| Esol Class | Highly soluble |
| Functional Groups | CO, CO[C@H](C)O |
| Compound Name | alpha-L-arabinofuranose |
| Kingdom | Organic compounds |
| Exact Mass | 150.053 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 150.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 150.13 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4+,5+/m0/s1 |
| Smiles | C([C@H]1[C@@H]([C@H]([C@@H](O1)O)O)O)O |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Pentoses |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Althaea Officinalis (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279