17-alpha-hydroxywithanolide D
PubChem CID: 44423097
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 17-alpha-hydroxywithanolide D, CHEMBL388053 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 120.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCCC23CC2CC2C4CCC(CC5CCCCC5)C4CCC2C13 |
| Np Classifier Class | Ergostane steroids |
| Deep Smiles | CC=CC)C[C@@H]OC6O)))[C@@][C@@]O)CC[C@@H][C@]5C)CC[C@H][C@H]6C[C@@H][C@][C@]6C)C=O)C=C[C@@H]6O))))))O3)))))))))))))O)C |
| Heavy Atom Count | 35.0 |
| Classyfire Class | Steroids and steroid derivatives |
| Scaffold Graph Node Level | OC1CCCC23OC2CC2C4CCC(CC5CCCCO5)C4CCC2C13 |
| Classyfire Subclass | Pregnane steroids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1040.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 11.0 |
| Iupac Name | (1S,2R,6S,7R,9R,11S,12S,15R,16S)-6,15-dihydroxy-15-[(1S)-1-hydroxy-1-[(2R)-6-hydroxy-4,5-dimethyl-3,6-dihydro-2H-pyran-2-yl]ethyl]-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-3-one |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 0.8 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C28H40O7 |
| Scaffold Graph Node Bond Level | O=C1C=CCC23OC2CC2C4CCC(CC5CC=CCO5)C4CCC2C13 |
| Prediction Swissadme | 1.0 |
| Inchi Key | IFECWTDQYRRRPG-SQURXFQPSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8214285714285714 |
| Logs | -4.298 |
| Rotatable Bond Count | 2.0 |
| Logd | 2.511 |
| Synonyms | 17-alpha-hydroxywithanolide |
| Esol Class | Soluble |
| Functional Groups | CC1=C(C)C(O)OCC1, CC=CC(C)=O, CO, C[C@H]1O[C@@]1(C)C |
| Compound Name | 17-alpha-hydroxywithanolide D |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 488.277 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 488.277 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 488.6 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 12.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.2225502000000006 |
| Inchi | InChI=1S/C28H40O7/c1-14-12-21(34-23(31)15(14)2)26(5,32)27(33)11-9-17-16-13-22-28(35-22)20(30)7-6-19(29)25(28,4)18(16)8-10-24(17,27)3/h6-7,16-18,20-23,30-33H,8-13H2,1-5H3/t16-,17-,18-,20-,21+,22+,23?,24-,25-,26-,27+,28+/m0/s1 |
| Smiles | CC1=C(C(O[C@H](C1)[C@@](C)([C@]2(CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3C[C@@H]5[C@]6([C@@]4(C(=O)C=C[C@@H]6O)C)O5)C)O)O)O)C |
| Nring | 6.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Steroids |
- 1. Outgoing r'ship
FOUND_INto/from Tubocapsicum Anomalum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Withania Somnifera (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279