(+/-)-6-Acetonyldihydrochelerythrine
PubChem CID: 443700
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6-Acetonyldihydrochelerythrine, (+/-)-6-Acetonyldihydrochelerythrine, 1-(1,2-dimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)propan-2-one, 1-(1,2-dimethoxy-12-methyl-13H-[1,3]benzodioxolo[6,5-c]phenanthridin-13-yl)propan-2-one, 8-Acetonyldihydrochelerythrine, CHEMBL3810342, CHEBI:31021, [1,3]Benzodioxolo[5,6-c]phenanthridine, 2-propanone deriv., 13-(2-Oxopropyl)dihydrochelerythrine, 13-Acetonyldihydrochelerythrine, Acetonylchelerythrine, Acetonyldihydrochelerythrine, , XAA86492, 6-Acetonyl-5,6-dihydrochelerythrine, FS-9626, Q27114071, [1,3]Benzodioxolo[5,6-c]phenanthridinium, 1,2-dimethoxy-12-methyl-6-(2-oxopropyl)-, 1-(1,2-Dimethoxy-12-methyl-12,13-dihydro-[1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-13-yl)-propan-2-one, 1-(1,2-Dimethoxy-12-methyl-12,13-dihydro-[1,3]dioxolo[4',5':4,5]benzo[1,2-c]phenanthridin-13-yl)propan-2-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 57.2 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CC3CCC4C5CCCCC5CCC4C3CC2C1 |
| Np Classifier Class | Isoquinoline alkaloids |
| Deep Smiles | COccOC))ccc-ccNCc%106)CC=O)C))))C))cccOCOc5cc9cc%13 |
| Heavy Atom Count | 30.0 |
| Classyfire Class | Benzophenanthridine alkaloids |
| Scaffold Graph Node Level | C1CCC2C(C1)CNC1C3CC4OCOC4CC3CCC21 |
| Classyfire Subclass | Dihydrobenzophenanthridine alkaloids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 643.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | n.a. |
| Iupac Name | 1-(1,2-dimethoxy-12-methyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-yl)propan-2-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 3.9 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C24H23NO5 |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)CNc1c-2ccc2cc3c(cc12)OCO3 |
| Prediction Swissadme | 1.0 |
| Inchi Key | VGTQLFWIJIABSU-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.2916666666666667 |
| Logs | -6.445 |
| Rotatable Bond Count | 4.0 |
| Logd | 3.66 |
| Synonyms | 8-acetonyldihydrochelerythrine |
| Esol Class | Moderately soluble |
| Functional Groups | CC(C)=O, c1cOCO1, cN(C)C, cOC |
| Compound Name | (+/-)-6-Acetonyldihydrochelerythrine |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 405.158 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 405.158 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 405.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.966656666666667 |
| Inchi | InChI=1S/C24H23NO5/c1-13(26)9-18-22-15(7-8-19(27-3)24(22)28-4)16-6-5-14-10-20-21(30-12-29-20)11-17(14)23(16)25(18)2/h5-8,10-11,18H,9,12H2,1-4H3 |
| Smiles | CC(=O)CC1C2=C(C=CC(=C2OC)OC)C3=C(N1C)C4=CC5=C(C=C4C=C3)OCO5 |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Agastache Mexicana (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Ammi Majus (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Antirrhinum Majus (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Argemone Mexicana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Argemone Ochroleuca (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Argemone Subfusiformis (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Artemisia Ludoviciana (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Artemisia Mexicana (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Chelidonium Majus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Illicium Majus (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Lippia Mexicana (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Orthosphenia Mexicana (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Papaver Argemone (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Persea Mexicana (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Pistacia Mexicana (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Ratibida Mexicana (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Rotala Mexicana (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Toddalia Asiatica (Plant) Rel Props:Reference:ISBN:9788185042114 - 19. Outgoing r'ship
FOUND_INto/from Tropaeolum Majus (Plant) Rel Props:Reference: