Calystegin A3
PubChem CID: 442999
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Calystegin A3, C10850, (2R,3R)-8-azabicyclo[3.2.1]octane-1,2,3-triol, AC1L9DTZ, (2R,3R)-8-azabicyclo(3.2.1)octane-1,2,3-triol, (3R,4R)-8-azabicyclo[3.2.1]octane-3,4,5-triol, CHEBI:3336, DTXSID30927276, Q27106030 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 72.7 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CC2CCC(C1)C2 |
| Np Classifier Class | Tropane alkaloids |
| Deep Smiles | O[C@@H]CCCCC[C@@H]7O))N5)O |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Tropane alkaloids |
| Scaffold Graph Node Level | C1CC2CCC(C1)N2 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 175.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2R,3R)-8-azabicyclo[3.2.1]octane-1,2,3-triol |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | -1.5 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C7H13NO3 |
| Scaffold Graph Node Bond Level | C1CC2CCC(C1)N2 |
| Inchi Key | XOCBOVUINUHZJA-RKXXOXFUSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | calystegine a3 |
| Esol Class | Highly soluble |
| Functional Groups | CNC(C)(C)O, CO |
| Compound Name | Calystegin A3 |
| Exact Mass | 159.09 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 159.09 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 159.18 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C7H13NO3/c9-5-3-4-1-2-7(11,8-4)6(5)10/h4-6,8-11H,1-3H2/t4?,5-,6-,7?/m1/s1 |
| Smiles | C1CC2([C@@H]([C@@H](CC1N2)O)O)O |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Ornithine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Atropa Belladonna (Plant) Rel Props:Reference:https://doi.org/10.1093/database/bav075