Epigallocatechin-(4beta->8)-epicatechin-3-O-gallate ester
PubChem CID: 442678
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Epigallocatechin-(4beta->8)-epicatechin-3-O-gallate ester, 126715-82-0, [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2R,3R,4R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate, Epigallocatechin-(4beta->8)-epicatechin 3-O-gallate, 22RQB22ZCB, CHEBI:4807, DTXSID60331903, LMPK12030008, Epigallocatechin(4b->8)epicatechin 3-O-gallate, Epigallocatechin-(4beta->8)-epicatechin-3-O-gallate, Q27106485, (2R,2'R,3R,3'R,4R)-2'-(3,4-Dihydroxyphenyl)-3,3',4,4'-tetrahydro-3,5,5',7,7'-pentahydroxy-2-(3,4,5-trihydroxyphenyl)[4,8'-bi-2H-1-benzopyran]-3'-yl 3,4,5-trihydroxybenzoate, [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2R,3R,4R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-3-yl]3,4,5-trihydroxybenzoate, Benzoic acid, 3,4,5-trihydroxy-, (2R,2'R,3R,3'R,4R)-2'-(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-3,5,5',7,7'-pentahydroxy-2-(3,4,5-trihydroxyphenyl)[4,8'-bi-2H-1-benzopyran]-3'-yl ester, Benzoic acid, 3,4,5-trihydroxy-, 2'-(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-3,5,5',7,7'-pentahydroxy-2-(3,4,5-trihydroxyphenyl)[4,8'-bi-2H-1-benzopyran]-3'-yl ester, [2R-[2alpha,3alpha,4beta(2'R*,3'R*)]]- |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 308.0 |
| Hydrogen Bond Donor Count | 13.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CC1CC2CCCC(C3CC(C4CCCCC4)CC4CCCCC43)C2CC1C1CCCCC1)C1CCCCC1 |
| Np Classifier Class | Proanthocyanins |
| Deep Smiles | OcccO)ccc6)O[C@@H][C@@H][C@H]6ccO)cccc6O[C@@H][C@@H]C6)OC=O)cccO)ccc6)O))O))))))))cccccc6)O))O)))))))))O))))))O))cccO)ccc6)O))O |
| Heavy Atom Count | 54.0 |
| Classyfire Class | Flavonoids |
| Description | Isolated from tea Thea sinensis. Epigallocatechin-(4beta->8)-epicatechin 3'-gallate is found in tea. |
| Scaffold Graph Node Level | OC(OC1CC2CCCC(C3CC(C4CCCCC4)OC4CCCCC43)C2OC1C1CCCCC1)C1CCCCC1 |
| Classyfire Subclass | Biflavonoids and polyflavonoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1270.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | [(2R,3R)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[(2R,3R,4R)-3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Flavonoids |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 3.2 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | True |
| Subclass | Biflavonoids and polyflavonoids |
| Gsk 4 400 Rule | False |
| Molecular Formula | C37H30O17 |
| Scaffold Graph Node Bond Level | O=C(OC1Cc2cccc(C3CC(c4ccccc4)Oc4ccccc43)c2OC1c1ccccc1)c1ccccc1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | LQQNPVZIFKLQPE-RGOYVLDUSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.1621621621621621 |
| Logs | -4.991 |
| Rotatable Bond Count | 6.0 |
| Logd | 1.131 |
| Synonyms | Epigallocatechin-(4beta->8)-epicatechin 3-gallate, Epigallocatechin-(4beta->8)-epicatechin 3'-gallate, Epigallocatechin-(4beta->8)-epicatechin-3-O-gallate, Epigallocatechin-(4beta->8)-epicatechin-3-O-gallate ester, Epigallocatechin(4b->8)epicatechin 3-O-gallate, Epigallocatechin-(4b->8)-epicatechin 3-O-gallate, Epigallocatechin-(4b->8)-epicatechin 3-O-gallic acid, Epigallocatechin-(4beta->8)-epicatechin 3-O-gallic acid, Epigallocatechin-(4β->8)-epicatechin 3-O-gallate, Epigallocatechin-(4β->8)-epicatechin 3-O-gallic acid, Epigallocatechin-(4b->8)-epicatechin-3-O-gallate ester, Epigallocatechin-(4b->8)-epicatechin-3-O-gallic acid ester, Epigallocatechin-(4beta->8)-epicatechin-3-O-gallic acid ester, Epigallocatechin-(4β->8)-epicatechin-3-O-gallate ester, Epigallocatechin-(4β->8)-epicatechin-3-O-gallic acid ester, Epigallocatechin-(4b->8)-epicatechin 3'-gallate, Epigallocatechin-(4b->8)-epicatechin 3'-gallic acid, Epigallocatechin-(4beta->8)-epicatechin 3'-gallic acid, Epigallocatechin-(4β->8)-epicatechin 3'-gallate, Epigallocatechin-(4β->8)-epicatechin 3'-gallic acid, epicatechin(4beta¡ú8)epigallocatechin 3-o-gallate, epigallocatechin (4beta->, 8)- epigallocatechin-3-o-gallate ester |
| Esol Class | Poorly soluble |
| Functional Groups | CO, cC(=O)OC, cO, cOC |
| Compound Name | Epigallocatechin-(4beta->8)-epicatechin-3-O-gallate ester |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 746.148 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 746.148 |
| Hydrogen Bond Acceptor Count | 17.0 |
| Molecular Weight | 746.6 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | False |
| Esol | -6.487617111111114 |
| Inchi | InChI=1S/C37H30O17/c38-15-8-20(42)28-26(9-15)52-35(13-4-22(44)31(48)23(45)5-13)33(50)30(28)29-21(43)11-18(40)16-10-27(53-37(51)14-6-24(46)32(49)25(47)7-14)34(54-36(16)29)12-1-2-17(39)19(41)3-12/h1-9,11,27,30,33-35,38-50H,10H2/t27-,30-,33-,34-,35-/m1/s1 |
| Smiles | C1[C@H]([C@H](OC2=C1C(=CC(=C2[C@@H]3[C@H]([C@H](OC4=CC(=CC(=C34)O)O)C5=CC(=C(C(=C5)O)O)O)O)O)O)C6=CC(=C(C=C6)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
| Nring | 7.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Biflavonoids and polyflavonoids |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Angelica Sinensis (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Aquilaria Sinensis (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Bretschneidera Sinensis (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Camellia Japonica (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Camellia Oleifera (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Camellia Saluenensis (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Camellia Sasanqua (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Camellia Thea (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Cephalotaxus Sinensis (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Chaenomeles Sinensis (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Cordia Sinensis (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Cordyceps Sinensis (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Cryptolepis Sinensis (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Diphylleia Sinensis (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Dolichos Sinensis (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Gleditsia Sinensis (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Incarvillea Sinensis (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Juglans Sinensis (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Macaranga Sinensis (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Miliusa Sinensis (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Miscanthus Sinensis (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Myrica Esculenta (Plant) Rel Props:Reference:ISBN:9788171360536 - 25. Outgoing r'ship
FOUND_INto/from Neottia Sinensis (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Nyssa Sinensis (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Pseudotsuga Sinensis (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Saccharum Sinensis (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Scopolia Sinensis (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Selaginella Sinensis (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Spiranthes Sinensis (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Tinospora Sinensis (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Toona Sinensis (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Uncaria Sinensis (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Wisteria Sinensis (Plant) Rel Props:Reference: