3,6,9-Trimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one
PubChem CID: 4426320
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 74299-48-2, 3,6,9-trimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one, 3,6,9-trimethylene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one, Azuleno[4,5-b]furan-2(3H)-one, decahydro-3,6,9-tris(methylene)-,(3aS,6aR,9aR,9bS)-, 16836-47-8, (-)-Dehydrocostus lactone, Epiligulyl oxide, Dehydro-alpha-curcumene, (Rac)-Dehydrocostus Lactone, SCHEMBL936050, CHEMBL1939730, CHEBI:181589, NETSQGRTUNRXEO-UHFFFAOYSA-N, AKOS015894380, AS-73882, CS-0503767, A827324, 3,6,9-TRIMETHYLIDENE-DODECAHYDROAZULENO[4,5-B]FURAN-2-ONE, 3,6,9-TRIMETHYLIDENE-OCTAHYDROAZULENO[4,5-B]FURAN-2-ONE, 3,6,9-trimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]uran-2-one |
|---|---|
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 17.0 |
| Description | Dehydrocostus lactone, also known as dehydro-alpha-curcumene, belongs to guaianolides and derivatives class of compounds. Those are diterpene lactones with a structure characterized by the presence of a gamma-lactone fused to a guaiane, forming 3,6,9-trimethyl-azuleno[4,5-b]furan-2-one or a derivative. Dehydrocostus lactone is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Dehydrocostus lactone can be found in burdock and sweet bay, which makes dehydrocostus lactone a potential biomarker for the consumption of these food products. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 432.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P03372 |
| Iupac Name | 3,6,9-trimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Class | Prenol lipids |
| Xlogp | 2.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Terpene lactones |
| Molecular Formula | C15H18O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | NETSQGRTUNRXEO-UHFFFAOYSA-N |
| Fcsp3 | 0.5333333333333333 |
| Logs | -3.506 |
| Rotatable Bond Count | 0.0 |
| Logd | 2.537 |
| Synonyms | dehydro-Alpha-Curcumene, dehydro-a-Curcumene, dehydro-α-curcumene |
| Compound Name | 3,6,9-Trimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 230.131 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 230.131 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 230.3 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Esol | -2.9185033999999996 |
| Inchi | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h11-14H,1-7H2 |
| Smiles | C=C1CCC2C(C3C1CCC3=C)OC(=O)C2=C |
| Nring | 3.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Guaianolides and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Abies Nobilis (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Acrisione Denticulata (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Aloe Nobilis (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Anthemis Nobilis (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Arctium Lappa (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Arnebia Nobilis (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Artocarpus Nobilis (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Citrus Nobilis (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Dolomiaea Souliei (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Ilex Denticulata (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Ixeris Denticulata (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Laurus Nobilis (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Macaranga Denticulata (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Primula Denticulata (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Saussurea Lappa (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Ventilago Denticulata (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Vepris Nobilis (Plant) Rel Props:Reference: