Kaempferol 3-glucosyl-(1->2)-(6''-acetylgalactoside)-7-glucoside
PubChem CID: 44259040
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Kaempferol 3-glucosyl-(1->2)-(6''-acetylgalactoside)-7-glucoside, LMPK12111970 |
|---|---|
| Topological Polar Surface Area | 351.0 |
| Hydrogen Bond Donor Count | 12.0 |
| Inchi Key | DQCLINUMJUZKAR-DTRLZUIWSA-N |
| Rotatable Bond Count | 12.0 |
| Heavy Atom Count | 57.0 |
| Compound Name | Kaempferol 3-glucosyl-(1->2)-(6''-acetylgalactoside)-7-glucoside |
| Description | Kaempferol 3-glucosyl-(1->2)-(6''-acetylgalactoside)-7-glucoside is a member of the class of compounds known as flavonoid-7-o-glycosides. Flavonoid-7-o-glycosides are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position. Thus, kaempferol 3-glucosyl-(1->2)-(6''-acetylgalactoside)-7-glucoside is considered to be a flavonoid lipid molecule. Kaempferol 3-glucosyl-(1->2)-(6''-acetylgalactoside)-7-glucoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Kaempferol 3-glucosyl-(1->2)-(6''-acetylgalactoside)-7-glucoside can be found in fenugreek, which makes kaempferol 3-glucosyl-(1->2)-(6''-acetylgalactoside)-7-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 814.217 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 814.217 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1410.0 |
| Hydrogen Bond Acceptor Count | 22.0 |
| Molecular Weight | 814.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 9.0 |
| Iupac Name | [(3R,4S,6S)-3,4-dihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-3-yl]oxy-5-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| Total Atom Stereocenter Count | 15.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C35H42O22/c1-11(38)50-10-19-23(43)27(47)32(57-34-29(49)26(46)22(42)18(9-37)54-34)35(55-19)56-31-24(44)20-15(40)6-14(51-33-28(48)25(45)21(41)17(8-36)53-33)7-16(20)52-30(31)12-2-4-13(39)5-3-12/h2-7,17-19,21-23,25-29,32-37,39-43,45-49H,8-10H2,1H3/t17?,18?,19?,21-,22-,23+,25+,26+,27+,28?,29?,32?,33-,34+,35+/m1/s1 |
| Smiles | CC(=O)OCC1[C@@H]([C@@H](C([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O[C@H]4C([C@H]([C@@H](C(O4)CO)O)O)O)C5=CC=C(C=C5)O)O[C@H]6C([C@H]([C@@H](C(O6)CO)O)O)O)O)O |
| Xlogp | -2.7 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C35H42O22 |
- 1. Outgoing r'ship
FOUND_INto/from Trigonella Foenum-Graecum (Plant) Rel Props:Source_db:fooddb_chem_all