Kaempferol 3-rhamnosyl-(1->3)-rhamnosyl-(1->6)-glucoside
PubChem CID: 44258984
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Kaempferol 3-rhamnosyl-(1->3)-rhamnosyl-(1->6)-glucoside, LMPK12111914 |
|---|---|
| Topological Polar Surface Area | 304.0 |
| Hydrogen Bond Donor Count | 11.0 |
| Inchi Key | UYVBMGULWGRDQT-XRCHGPKSSA-N |
| Rotatable Bond Count | 8.0 |
| Heavy Atom Count | 52.0 |
| Compound Name | Kaempferol 3-rhamnosyl-(1->3)-rhamnosyl-(1->6)-glucoside |
| Description | Kaempferol 3-rhamnosyl-(1->3)-rhamnosyl-(1->6)-glucoside is a member of the class of compounds known as flavonoid-3-o-glycosides. Flavonoid-3-o-glycosides are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. Thus, kaempferol 3-rhamnosyl-(1->3)-rhamnosyl-(1->6)-glucoside is considered to be a flavonoid lipid molecule. Kaempferol 3-rhamnosyl-(1->3)-rhamnosyl-(1->6)-glucoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Kaempferol 3-rhamnosyl-(1->3)-rhamnosyl-(1->6)-glucoside can be found in tea, which makes kaempferol 3-rhamnosyl-(1->3)-rhamnosyl-(1->6)-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 740.216 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 740.216 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1260.0 |
| Hydrogen Bond Acceptor Count | 19.0 |
| Molecular Weight | 740.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 9.0 |
| Iupac Name | 3-[(2S,4S,5S)-6-[[(2R,3S,5S)-3,5-dihydroxy-6-methyl-4-[(2S,3S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| Total Atom Stereocenter Count | 15.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C33H40O19/c1-10-19(37)23(41)25(43)32(48-10)51-29-20(38)11(2)47-31(27(29)45)46-9-17-21(39)24(42)26(44)33(50-17)52-30-22(40)18-15(36)7-14(35)8-16(18)49-28(30)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-27,29,31-39,41-45H,9H2,1-2H3/t10?,11?,17?,19-,20-,21+,23?,24-,25-,26?,27-,29?,31+,32-,33-/m0/s1 |
| Smiles | CC1[C@@H](C([C@@H]([C@@H](O1)OC2[C@@H]([C@@H](OC([C@@H]2O)C)OCC3[C@H]([C@@H](C([C@@H](O3)OC4=C(OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)O)O)O)O)O)O)O)O |
| Xlogp | -2.0 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C33H40O19 |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all