Pongone
PubChem CID: 44257567
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Pongone, 7-(3-Methoxyphenyl)-5H-furo[3,2-g][1]benzopyran-5-one, 7-(3-methoxyphenyl)furo(3,2-g)chromen-5-one, 7-(3-methoxyphenyl)furo[3,2-g]chromen-5-one, CHEMBL224607, CHEBI:196229, LMPK12110011, 7-(3-methoxyphenyl)uro[3,2-g]chromen-5-one, 114687-96-6 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 48.7 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC(C2CCCCC2)CC2CC3CCCC3CC12 |
| Np Classifier Class | Flavones |
| Deep Smiles | COcccccc6)ccc=O)cco6)cccc6)cco5 |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Flavonoids |
| Scaffold Graph Node Level | OC1CC(C2CCCCC2)OC2CC3OCCC3CC12 |
| Classyfire Subclass | Flavones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 472.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 7-(3-methoxyphenyl)furo[3,2-g]chromen-5-one |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 3.6 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C18H12O4 |
| Scaffold Graph Node Bond Level | O=c1cc(-c2ccccc2)oc2cc3occc3cc12 |
| Inchi Key | URNICEODGHJCAQ-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | pongone, pongone [3"-methoxyfurano {4'',5"-6,7 }flavone] |
| Esol Class | Moderately soluble |
| Functional Groups | c=O, cOC, coc |
| Compound Name | Pongone |
| Exact Mass | 292.074 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 292.074 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 292.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C18H12O4/c1-20-13-4-2-3-11(7-13)17-9-15(19)14-8-12-5-6-21-16(12)10-18(14)22-17/h2-10H,1H3 |
| Smiles | COC1=CC=CC(=C1)C2=CC(=O)C3=C(O2)C=C4C(=C3)C=CO4 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Pongamia Pinnata (Plant) Rel Props:Reference:ISBN:9788172362461; ISBN:9788185042053; Standardization of Single Drugs of Unani Medicine Part - V