Tomentolide A
PubChem CID: 44257541
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Tomentolide A, CHEBI:188089, LMPK12100026, (10S,11R)-10,11,16,16-tetramethyl-6-phenyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,13,17-pentaene-4,12-dione |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 61.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC(C2CCCCC2)C2C(C1)C1CCCCC1C1C(C)CCCC12 |
| Np Classifier Class | Pyranocoumarins |
| Deep Smiles | C[C@@H]OccC=O)[C@@H]6C)))cOCC)C)C=Cc6cc%10ccc=O)o6)))cccccc6 |
| Heavy Atom Count | 30.0 |
| Classyfire Class | Neoflavonoids |
| Scaffold Graph Node Level | OC1CC(C2CCCCC2)C2C(O1)C1CCCOC1C1C(O)CCOC12 |
| Classyfire Subclass | Prenylated neoflavonoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 789.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (10S,11R)-10,11,16,16-tetramethyl-6-phenyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,7,13,17-pentaene-4,12-dione |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 4.5 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C25H22O5 |
| Scaffold Graph Node Bond Level | O=C1CCOc2c1c1c(c3oc(=O)cc(-c4ccccc4)c23)C=CCO1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | JCKXVEVCXNXGQW-KGLIPLIRSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.28 |
| Logs | -2.93 |
| Rotatable Bond Count | 1.0 |
| Logd | 2.504 |
| Synonyms | tomentolide a |
| Esol Class | Moderately soluble |
| Functional Groups | c=O, cC(C)=O, cC=CC, cOC, coc |
| Compound Name | Tomentolide A |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 402.147 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 402.147 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 402.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -5.038931866666667 |
| Inchi | InChI=1S/C25H22O5/c1-13-14(2)28-24-19-17(15-8-6-5-7-9-15)12-18(26)29-22(19)16-10-11-25(3,4)30-23(16)20(24)21(13)27/h5-14H,1-4H3/t13-,14+/m1/s1 |
| Smiles | C[C@@H]1[C@@H](OC2=C3C(=CC(=O)OC3=C4C=CC(OC4=C2C1=O)(C)C)C5=CC=CC=C5)C |
| Nring | 4.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Coumarins |
- 1. Outgoing r'ship
FOUND_INto/from Calophyllum Apetalum (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Calophyllum Austroindicum (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Calophyllum Brasiliense (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Calophyllum Calaba (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Calophyllum Caledonicum (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Calophyllum Dispar (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Calophyllum Inophyllum (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Calophyllum Lanigerum (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Calophyllum Moonii (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Calophyllum Polyanthum (Plant) Rel Props:Reference:ISBN:9788185042053 - 11. Outgoing r'ship
FOUND_INto/from Calophyllum Soulattri (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Calophyllum Teysmannii (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Calophyllum Thwaitesii (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Calophyllum Tomentosum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Calophyllum Trapezifolium (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Centrolobium Tomentosum (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Chondrodendron Tomentosum (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Clerodendrum Tomentosum (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Jasminum Calophyllum (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Nerium Tomentosum (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Rhododendron Tomentosum (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Sideroxylon Tomentosum (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Vincetoxicum Amplexicaule (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Vincetoxicum Atratum (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Vincetoxicum Forrestii (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Vincetoxicum Glaucescens (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Vincetoxicum Hirundinaria (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Vincetoxicum Pycnostelma (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 29. Outgoing r'ship
FOUND_INto/from Vincetoxicum Stauntonii (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Vincetoxicum Versicolor (Plant) Rel Props:Reference: