Repenol
PubChem CID: 44257428
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Repenol, 6a,12a-Dehydro-3,9,10,11-tetrahydroxy-6-acetoxyrotenone, methyl (3,9,10,11-tetrahydroxy-12-oxo-6H-chromeno(3,4-b)chromen-6-yl) carbonate, methyl (3,9,10,11-tetrahydroxy-12-oxo-6H-chromeno[3,4-b]chromen-6-yl) carbonate, LMPK12060080, 128486-16-8 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 152.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1C2CCCCC2CC2CCC3CCCCC3C21 |
| Np Classifier Class | Rotenoids |
| Deep Smiles | COC=O)OCOcccO)ccc6-cc%10occcO)ccc6c%10=O)))O))O |
| Heavy Atom Count | 28.0 |
| Classyfire Class | Isoflavonoids |
| Scaffold Graph Node Level | OC1C2CCCCC2OC2COC3CCCCC3C21 |
| Classyfire Subclass | Rotenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 690.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | methyl (3,9,10,11-tetrahydroxy-12-oxo-6H-chromeno[3,4-b]chromen-6-yl) carbonate |
| Nih Violation | False |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 2.3 |
| Is Pains | True |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H12O10 |
| Scaffold Graph Node Bond Level | O=c1c2c(oc3ccccc13)COc1ccccc1-2 |
| Inchi Key | MQAHKRVNVQQRHE-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | repenol |
| Esol Class | Soluble |
| Functional Groups | c=O, cO, cOC(c)OC(=O)OC, coc |
| Compound Name | Repenol |
| Exact Mass | 388.043 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 388.043 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 388.3 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C18H12O10/c1-25-18(24)28-17-16-11(7-3-2-6(19)4-9(7)27-17)14(22)12-10(26-16)5-8(20)13(21)15(12)23/h2-5,17,19-21,23H,1H3 |
| Smiles | COC(=O)OC1C2=C(C3=C(O1)C=C(C=C3)O)C(=O)C4=C(O2)C=C(C(=C4O)O)O |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Isoflavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Boerhavia Diffusa (Plant) Rel Props:Reference:ISBN:9788185042145