(+)-Dihydrowighteone
PubChem CID: 44257383
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (+)-Dihydrowighteone, (+)-5,7,4'-Trihydroxy-6-prenylisoflavanone, 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one, SCHEMBL13360710, CHEBI:186073, LMPK12050473, 108026-27-3 |
|---|---|
| Topological Polar Surface Area | 87.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | UYDQKAKPHFFLDY-UHFFFAOYSA-N |
| Rotatable Bond Count | 3.0 |
| Synonyms | (+)-5,7,4'-Trihydroxy-6-prenylisoflavanone |
| Heavy Atom Count | 25.0 |
| Compound Name | (+)-Dihydrowighteone |
| Description | (+)-dihydrowighteone is a member of the class of compounds known as isoflavanones. Isoflavanones are polycyclic compounds containing an isoflavan skeleton which bears a ketone at position C4. Thus, (+)-dihydrowighteone is considered to be a flavonoid lipid molecule (+)-dihydrowighteone is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). (+)-dihydrowighteone can be found in adzuki bean, which makes (+)-dihydrowighteone a potential biomarker for the consumption of this food product. |
| Exact Mass | 340.131 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 340.131 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 504.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 340.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| Total Atom Stereocenter Count | 1.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C20H20O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9,15,21-23H,8,10H2,1-2H3 |
| Smiles | CC(=CCC1=C(C2=C(C=C1O)OCC(C2=O)C3=CC=C(C=C3)O)O)C |
| Xlogp | 4.5 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C20H20O5 |
- 1. Outgoing r'ship
FOUND_INto/from Vigna Angularis (Plant) Rel Props:Source_db:fooddb_chem_all