Kakkalidone
PubChem CID: 44257344
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Kakkalidone, Irisolidone 7-O-glucoside, LMPK12050375 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 164.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1C(C2CCCCC2)CCC2CC(CC3CCCCC3)CCC21 |
| Np Classifier Class | Isoflavones |
| Deep Smiles | OCCO[C@@H]Occcoccc=O)c6cc%10OC)))O))))cccccc6))OC)))))))))))))C[C@H][C@@H]6O))O))O |
| Heavy Atom Count | 34.0 |
| Classyfire Class | Isoflavonoids |
| Scaffold Graph Node Level | OC1C(C2CCCCC2)COC2CC(OC3CCCCO3)CCC21 |
| Classyfire Subclass | Isoflavonoid o-glycosides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 736.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | 5-hydroxy-6-methoxy-3-(4-methoxyphenyl)-7-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 1.2 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C23H24O11 |
| Scaffold Graph Node Bond Level | O=c1c(-c2ccccc2)coc2cc(OC3CCCCO3)ccc12 |
| Prediction Swissadme | 0.0 |
| Inchi Key | XKNZYDKRYPYTHS-ZVIVNLKOSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.3478260869565217 |
| Logs | -4.009 |
| Rotatable Bond Count | 6.0 |
| Logd | 1.512 |
| Synonyms | irisolidone-7-o-glucoside |
| Esol Class | Soluble |
| Functional Groups | CO, c=O, cO, cOC, cO[C@@H](C)OC, coc |
| Compound Name | Kakkalidone |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 476.132 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 476.132 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 476.4 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -2.979226094117648 |
| Inchi | InChI=1S/C23H24O11/c1-30-11-5-3-10(4-6-11)12-9-32-13-7-14(22(31-2)19(27)16(13)17(12)25)33-23-21(29)20(28)18(26)15(8-24)34-23/h3-7,9,15,18,20-21,23-24,26-29H,8H2,1-2H3/t15?,18-,20+,21?,23-/m1/s1 |
| Smiles | COC1=CC=C(C=C1)C2=COC3=CC(=C(C(=C3C2=O)O)OC)O[C@H]4C([C@H]([C@@H](C(O4)CO)O)O)O |
| Nring | 4.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Isoflavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Annona Montana (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Aralia Montana (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Arnica Montana (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Artemisia Montana (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Bridelia Montana (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Briedelia Montana (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Cassia Montana (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Clematis Montana (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Corydalis Montana (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Curcuma Montana (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Diospyros Montana (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Glycosmis Montana (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Gymnosporia Montana (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Jasione Montana (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Jasonia Montana (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Jatropha Montana (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Knautia Montana (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Maesa Montana (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Magnolia Montana (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Pueraria Lobata (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Pueraria Montana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 22. Outgoing r'ship
FOUND_INto/from Pueraria Phaseoloides (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Pueraria Thomsonii (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Pueraria Tuberosa (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Ruta Montana (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Satureja Montana (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Senna Montana (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Vernicia Montana (Plant) Rel Props:Reference: