Rotundifolone
PubChem CID: 442497
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Rotundifolone, Piperitenone oxide, Lippione, 3564-96-3, cis-Piperitenone epoxide, Piperitenone oxide [FHFI], (+-)-Rotundifolone, FEMA No. 4199, (+-)-Piperitenone oxide, UNII-6FR5IOD112, (+)-Rotundifolone, Piperitenone oxide, (+-)-, 6FR5IOD112, (1S,6S)-6-methyl-3-propan-2-ylidene-7-oxabicyclo[4.1.0]heptan-2-one, 7-Oxabicyclo(4.1.0)heptan-2-one, 6-methyl-3-(1-methylethylidene)-, (1S)-, 7-Oxabicyclo(4.1.0)heptan-2-one, 6-methyl-3-(1-methylethylidene)-, (1S,6S)-, (1S,6S)-3-isopropylidene-6-methyl-7-oxabicyclo(4.1.0)heptan-2-one, (1S,6S)-3-isopropylidene-6-methyl-7-oxabicyclo[4.1.0]heptan-2-one, (1S,6S)-6-methyl-3-propan-2-ylidene-7-oxabicyclo(4.1.0)heptan-2-one, CHEBI:8900, SCHEMBL2317471, (+)-PIPERITENONE OXIDE, DTXSID301317536, PIPERITENONE OXIDE, (+)-, AKOS040753565, HY-134013, CS-0136507, C09896, Q27108176 |
|---|---|
| Topological Polar Surface Area | 29.6 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 12.0 |
| Description | (+)-rotundifolone, also known as lippione, is a member of the class of compounds known as oxepanes. Oxepanes are compounds containing an oxepane ring, which is a seven-member saturated aliphatic heterocycle with one oxygen and six carbon atoms (+)-rotundifolone is slightly soluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). (+)-rotundifolone can be found in spearmint, which makes (+)-rotundifolone a potential biomarker for the consumption of this food product. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 274.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (1S,6S)-6-methyl-3-propan-2-ylidene-7-oxabicyclo[4.1.0]heptan-2-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Oxepanes |
| Xlogp | 1.8 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Molecular Formula | C10H14O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | AKASWINDKIEEBO-ZJUUUORDSA-N |
| Fcsp3 | 0.7 |
| Logs | -1.252 |
| Rotatable Bond Count | 0.0 |
| Logd | 1.38 |
| Synonyms | Lippione |
| Compound Name | Rotundifolone |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 166.099 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 166.099 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 166.22 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Esol | -2.0234639999999997 |
| Inchi | InChI=1S/C10H14O2/c1-6(2)7-4-5-10(3)9(12-10)8(7)11/h9H,4-5H2,1-3H3/t9-,10+/m1/s1 |
| Smiles | CC(=C1CC[C@]2([C@@H](C1=O)O2)C)C |
| Nring | 2.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Oxepanes |
- 1. Outgoing r'ship
FOUND_INto/from Mentha Longifolia (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Mentha Rotundifolia (Plant) Rel Props:Source_db:npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Mentha Spicata (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Mentha Suaveolens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Uncaria Gambir (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all