6-Methoxy-alpha-pyrufuran
PubChem CID: 441795
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6-Methoxy-alpha-pyrufuran, 1,3,4,6-tetramethoxydibenzofuran-2-ol, 167278-44-6, 6-Methoxy-a-pyrufuran, 1,3,4,6-tetramethoxy-2-dibenzofuranol, DTXSID70331631, 2-Hydroxy-1,3,4,6-tetramethoxydibenzofuran, 3,5,6,10-tetramethoxy-8-oxatricyclo[7.4.0.0^{2,7}]trideca-1(13),2,4,6,9,11-hexaen-4-ol, 3,5,6,10-tetramethoxy-8-oxatricyclo(7.4.0.0^(2,7))trideca-1(13),2,4,6,9,11-hexaen-4-ol, 6-Methoxy-I+--pyrufuran, C08761, L5EMJ98LT4, CHEBI:2209, DTXCID20282725, 2-Dibenzofuranol, 1,3,4,6-tetramethoxy-, Q27105581 |
|---|---|
| Topological Polar Surface Area | 70.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 22.0 |
| Description | Constituent of the sapwood of Mespilus germanica (European medlar). 6-Methoxy-alpha-pyrufuran is found in medlar and fruits. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 378.0 |
| Database Name | fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1,3,4,6-tetramethoxydibenzofuran-2-ol |
| Nih Violation | False |
| Class | Benzofurans |
| Xlogp | 3.2 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Subclass | Dibenzofurans |
| Molecular Formula | C16H16O6 |
| Inchi Key | ZUMWPOBUQWYISM-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | 1,3,4,6-Tetramethoxy-2-dibenzofuranol, 2-Hydroxy-1,3,4,6-tetramethoxydibenzofuran, 6-Methoxy-a-pyrufuran, 6-Methoxy-alpha-pyrufuran |
| Substituent Name | Dibenzofuran, Methoxyphenol, Hydroxyquinol derivative, Anisole, Alkyl aryl ether, Benzenoid, Heteroaromatic compound, Furan, Oxacycle, Ether, Hydrocarbon derivative, Organooxygen compound, Aromatic heteropolycyclic compound |
| Compound Name | 6-Methoxy-alpha-pyrufuran |
| Kingdom | Organic compounds |
| Exact Mass | 304.095 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 304.095 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 304.29 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C16H16O6/c1-18-9-7-5-6-8-10-13(19-2)11(17)15(20-3)16(21-4)14(10)22-12(8)9/h5-7,17H,1-4H3 |
| Smiles | COC1=CC=CC2=C1OC3=C2C(=C(C(=C3OC)OC)O)OC |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Mespilus Germanica (Plant) Rel Props:Source_db:fooddb_chem_all