Luteolinidin
PubChem CID: 441701
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Luteolinidin, Luteolinidin cation, Luteolinidin ion, 2-(3,4-dihydroxyphenyl)chromenylium-5,7-diol, 16975-93-2, UNII-935OS7WHP6, 935OS7WHP6, CHEBI:6584, 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-1$l^{4}-chromen-1-ylium, DTXSID20921728, NSC693578, Luteolidin, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-1$l^(4)-chromen-1-ylium, SCHEMBL676808, 2-(3,4-Dihydroxy-phenyl)-5,7-dihydroxy-chromenylium, CHEMBL1275834, DTXCID301767018, 5,7,3',4'-Tetrahydroxyflavylium, BDBM50347144, NCI60_033512, C08652, Q3062931, 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-1-benzopyrylium(1+), 9CI, 601-367-5 |
|---|---|
| Topological Polar Surface Area | 81.9 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 20.0 |
| Description | Luteolinidin is a chemical compound belonging to the 3-deoxyanthocyanidins and that can be found in Sorghum bicolor. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 336.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-(3,4-dihydroxyphenyl)chromenylium-5,7-diol |
| Nih Violation | True |
| Class | Flavonoids |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | True |
| Subclass | Hydroxyflavonoids |
| Molecular Formula | C15H11O5+ |
| Inchi Key | GDNIGMNXEKGFIP-UHFFFAOYSA-O |
| Rotatable Bond Count | 1.0 |
| Synonyms | 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-1-benzopyrylium(1+), 9CI, 5,7,3',4'-Tetrahydroxyflavylium, Luteolidin, 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-1-benzopyrylium(1+), 9ci |
| Substituent Name | 7-hydroxyflavonoid, 5-hydroxyflavonoid, 4'-hydroxyflavonoid, 3'-hydroxyflavonoid, Anthocyanidin, 1-benzopyran, Benzopyran, Resorcinol, 1,2-diphenol, Phenol, Benzenoid, Monocyclic benzene moiety, Heteroaromatic compound, Oxacycle, Organoheterocyclic compound, Hydrocarbon derivative, Organooxygen compound, Organic cation, Aromatic heteropolycyclic compound |
| Compound Name | Luteolinidin |
| Kingdom | Organic compounds |
| Exact Mass | 271.061 |
| Formal Charge | 1.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 271.061 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 271.24 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Inchi | InChI=1S/C15H10O5/c16-9-6-12(18)10-2-4-14(20-15(10)7-9)8-1-3-11(17)13(19)5-8/h1-7H,(H3-,16,17,18,19)/p+1 |
| Smiles | C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2)O)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | 7-hydroxyflavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all