Bullatacinone
PubChem CID: 441557
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Bullatacinone, AC1L9BBA, Asimicinone, (3S,5R)-5-[(11R)-11-hydroxy-11-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one, C08470, 123012-00-0, 2,4-trans-asimicinone, (3S,5R)-3-acetonyl-5-[(11R)-11-hydroxy-11-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-hydroxyundecyl]tetrahydrofuran-2-yl]tetrahydrofuran-2-yl]undecyl]tetrahydrofuran-2-one, (2,4-Cis/Trans)-Squamolinone, (3S,5R)-3-acetonyl-5-((11R)-11-hydroxy-11-((2R,5R)-5-((2R,5R)-5-((1S)-1-hydroxyundecyl)tetrahydrofuran-2-yl)tetrahydrofuran-2-yl)undecyl)tetrahydrofuran-2-one, (3S,5R)-5-((11R)-11-hydroxy-11-((2R,5R)-5-((2R,5R)-5-((1S)-1-hydroxyundecyl)oxolan-2-yl)oxolan-2-yl)undecyl)-3-(2-oxopropyl)oxolan-2-one, (5s)-5-((11r)-11-hydroxy-11-((2r,2'r,5s,5's)-5'-((1r)-1-hydroxyundecyl)-(2,2'-bioxolan)-5-yl)undecyl)-3-(2-oxopropyl)oxolan-2-one, (5s)-5-[(11r)-11-hydroxy-11-[(2r,2'r,5s,5's)-5'-[(1r)-1-hydroxyundecyl]-[2,2'-bioxolan]-5-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one, CHEBI:3212, DTXSID201317707, 189686-30-4, 2(3H)-Furanone, dihydro-5-(11-hydroxy-11-(octahydro-5'-(`1-hydroxyundecyl)(2,2'-bifuran)-5-yl)undecyl)-3-(2-oxopropyl)-, (2S-(2alpha(2'R*,5'R*(R*)),5beta(S*(5R*))))-, Q27105994, 2(3H)-Furanone, dihydro-5-(11-hydroxy-11-(octahydro-5'-(1-hydroxyundecyl)(2,2'-bifuran)-5-yl)undecyl)-3-(2-oxopropyl)-, (2S-(2alpha(2'R*,5'R*(R*)),5beta(S*(5R*))))- |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 102.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC(CCCCCCCCCCCC2CCC(C3CCCC3)C2)C1 |
| Np Classifier Class | Acetogenins |
| Deep Smiles | CCCCCCCCCC[C@@H][C@H]CC[C@@H]O5)[C@H]CC[C@@H]O5)[C@@H]CCCCCCCCCC[C@@H]C[C@H]C=O)O5))CC=O)C))))))))))))))))O))))))))))O |
| Heavy Atom Count | 44.0 |
| Classyfire Class | Fatty acyls |
| Scaffold Graph Node Level | OC1CCC(CCCCCCCCCCCC2CCC(C3CCCO3)O2)O1 |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 788.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 8.0 |
| Iupac Name | (3S,5R)-5-[(11R)-11-hydroxy-11-[(2R,5R)-5-[(2R,5R)-5-[(1S)-1-hydroxyundecyl]oxolan-2-yl]oxolan-2-yl]undecyl]-3-(2-oxopropyl)oxolan-2-one |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 9.4 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C37H66O7 |
| Scaffold Graph Node Bond Level | O=C1CCC(CCCCCCCCCCCC2CCC(C3CCCO3)O2)O1 |
| Inchi Key | KGGVWMAPBXIMEM-ZRTAFWODSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 25.0 |
| Synonyms | bullatacinone |
| Esol Class | Poorly soluble |
| Functional Groups | CC(=O)OC, CC(C)=O, CO, COC |
| Compound Name | Bullatacinone |
| Exact Mass | 622.481 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 622.481 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 622.9 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | False |
| Inchi | InChI=1S/C37H66O7/c1-3-4-5-6-7-11-14-17-20-31(39)33-22-24-35(43-33)36-25-23-34(44-36)32(40)21-18-15-12-9-8-10-13-16-19-30-27-29(26-28(2)38)37(41)42-30/h29-36,39-40H,3-27H2,1-2H3/t29-,30-,31+,32-,33-,34-,35-,36-/m1/s1 |
| Smiles | CCCCCCCCCC[C@@H]([C@H]1CC[C@@H](O1)[C@H]2CC[C@@H](O2)[C@@H](CCCCCCCCCC[C@@H]3C[C@H](C(=O)O3)CC(=O)C)O)O |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Linear polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Annona Cherimola (Plant) Rel Props:Reference:ISBN:9788185042145 - 2. Outgoing r'ship
FOUND_INto/from Annona Squamosa (Plant) Rel Props:Reference:ISBN:9788172363130; ISBN:9788185042145