Amataine
PubChem CID: 441539
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Amataine, Subssesiline, CHEBI:2625, 31148-60-4, CHEMBL3325767, methyl (1R,2R,6R,17R,21R,23R,31R,37S,41R,43S,46S,47R)-26-methoxy-3,22,38-trioxa-10,20,24,34-tetrazatetradecacyclo[22.20.1.16,17.131,34.01,21.02,6.09,17.011,16.023,31.023,43.025,30.037,41.020,47.041,46]heptatetraconta-8,11,13,15,25(30),26,28-heptaene-8-carboxylate, Grandifoline, methyl ent-6beta,21, 8beta,2', O~8~,8-Cyclovobtusine, C08433, DTXSID50953239, BDBM50044111, Q27105743, 6'beta,21'-triepoxy-17'-methoxy-2,3-didehydro-(7alphaC4'',3'beta)-3',4''-dihydro-2'H-spiro[aspidospermidine-7,5''-pyrido[1',2',3':1,2,3]aspidospermidine]-3-carboxylate, methyl ent-6beta,21, 8beta,2', 6'beta,21'-triepoxy-17'-methoxy-2,3-didehydro-(7alphaC4'',3'beta)-3',4''-dihydro-2'H-spiro[aspidospermidine-7,5''-pyrido[1',2',3':1,2,3]aspidospermidine]-3-carboxylate |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 85.0 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CC1CCC34CCCC3C35CC6CC78CCCC7CCC7CCC9(C%10CCCCC%10C(C3)C69CC5C3CCC12C34)C78 |
| Np Classifier Class | Aporphine alkaloids, Aspidosperma type |
| Deep Smiles | COC=O)C=CNcc[C@]5[C@@H][C@@]C9)CCO[C@H]5[C@@][C@H]N9CC%12)))O[C@][C@H]C6)C[C@@][C@H][C@]6ccN9C%13))cOC))ccc6))))))CCN5CC[C@@H]9OCC%12)))))))))))))))))))))))))cccc6 |
| Heavy Atom Count | 53.0 |
| Classyfire Class | Aspidospermatan-type alkaloids |
| Scaffold Graph Node Level | C1CCC2C(C1)NC1CCC34CCOC3C35CC6CC78CCOC7CCN7CCC9(C%10CCCCC%10N(C3)C69OC5N3CCC12C34)C78 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1730.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 12.0 |
| Uniprot Id | Q8R4D5, Q8NER1 |
| Iupac Name | methyl (1R,2R,6R,17R,21R,23R,31R,37S,41R,43S,46S,47R)-26-methoxy-3,22,38-trioxa-10,20,24,34-tetrazatetradecacyclo[22.20.1.16,17.131,34.01,21.02,6.09,17.011,16.023,31.023,43.025,30.037,41.020,47.041,46]heptatetraconta-8,11,13,15,25(30),26,28-heptaene-8-carboxylate |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Alkaloids and derivatives |
| Xlogp | 4.5 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C43H48N4O6 |
| Scaffold Graph Node Bond Level | C1=C2Nc3ccccc3C23CCN2C4OC56C7CC4(CN5c4ccccc4C64CCN5CCC6OCCC6(C7)C54)C4OCCC4(C1)C23 |
| Inchi Key | RZBFPDQKWUWUCK-SFUBKHQQSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | amataine |
| Esol Class | Poorly soluble |
| Functional Groups | CN(C)C, COC, cN1CC[C@H](N(C)C)O[C@]1(C)C, cNC(C)=C(C)C(=O)OC, cOC |
| Compound Name | Amataine |
| Exact Mass | 716.357 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 716.357 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 716.9 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 12.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C43H48N4O6/c1-49-29-9-5-7-27-31(29)47-23-40-21-24-20-38-13-18-51-30(38)10-15-45-16-12-42(27,35(38)45)43(24,47)53-37(40)46-17-11-41-26-6-3-4-8-28(26)44-32(41)25(33(48)50-2)22-39(34(41)46)14-19-52-36(39)40/h3-9,24,30,34-37,44H,10-23H2,1-2H3/t24-,30-,34-,35-,36+,37+,38+,39-,40+,41-,42+,43+/m0/s1 |
| Smiles | COC1=CC=CC2=C1N3C[C@@]45C[C@H]6[C@]3([C@]27CCN8[C@H]7[C@@]9(C6)CCO[C@H]9CC8)O[C@H]4N1CC[C@@]23[C@@H]1[C@@]1([C@H]5OCC1)CC(=C2NC1=CC=CC=C31)C(=O)OC |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tryptophan alkaloids, Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Aloe Africana (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Antiaris Africana (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Callichilia Barteri (Plant) Rel Props:Reference:ISBN:9770972795006 - 4. Outgoing r'ship
FOUND_INto/from Canavalia Africana (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Entada Africana (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Galenia Africana (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Kigelia Africana (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Kiggelaria Africana (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Mammea Africana (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Myrsine Africana (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Prosopis Africana (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Prunus Africana (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Quassia Africana (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Uncaria Africana (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Voacanga Foetida (Plant) Rel Props:Reference: