(2R,3R,4R)-2-methoxy-3,4-dihydro-2H-pyran-3,4,5-triol
PubChem CID: 44149648
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | UNII-M7F3LRN53I, M7F3LRN53I, EINECS 215-755-3 |
|---|---|
| Topological Polar Surface Area | 79.2 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | FSOIXBFBUZWTMV-KVQBGUIXSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | Lichenan |
| Heavy Atom Count | 11.0 |
| Compound Name | (2R,3R,4R)-2-methoxy-3,4-dihydro-2H-pyran-3,4,5-triol |
| Kingdom | Organic compounds |
| Description | Lichenin, also known as lichenan or moss starch, is a complex glucan occurring in certain species of lichens. It can be extracted from Cetraria islandica (Iceland moss). It has been studied since about 1957. Chemically, lichenin consists of repeating glucose units linked by β-1,3 and β-1,4 glycosidic bonds . Lichenin is soluble (in water) and a very weakly acidic compound (based on its pKa). Lichenin can be found in oat, which makes lichenin a potential biomarker for the consumption of this food product. |
| Exact Mass | 162.053 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 162.053 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 166.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 162.14 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (2R,3R,4R)-2-methoxy-3,4-dihydro-2H-pyran-3,4,5-triol |
| Total Atom Stereocenter Count | 3.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Organooxygen compounds |
| Inchi | InChI=1S/C6H10O5/c1-10-6-5(9)4(8)3(7)2-11-6/h2,4-9H,1H3/t4-,5+,6+/m0/s1 |
| Smiles | CO[C@H]1[C@@H]([C@H](C(=CO1)O)O)O |
| Xlogp | -1.6 |
| Superclass | Organic oxygen compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Alcohols and polyols |
| Taxonomy Direct Parent | 1,2-diols |
| Molecular Formula | C6H10O5 |
- 1. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:fooddb_chem_all