(2R,3R,4R)-2-methoxy-3,4-dihydro-2H-pyran-3,4,5-triol
PubChem CID: 44149648
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | UNII-M7F3LRN53I, M7F3LRN53I, EINECS 215-755-3 |
|---|---|
| Topological Polar Surface Area | 79.2 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 11.0 |
| Description | Lichenin, also known as lichenan or moss starch, is a complex glucan occurring in certain species of lichens. It can be extracted from Cetraria islandica (Iceland moss). It has been studied since about 1957. Chemically, lichenin consists of repeating glucose units linked by β-1,3 and β-1,4 glycosidic bonds . Lichenin is soluble (in water) and a very weakly acidic compound (based on its pKa). Lichenin can be found in oat, which makes lichenin a potential biomarker for the consumption of this food product. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 166.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (2R,3R,4R)-2-methoxy-3,4-dihydro-2H-pyran-3,4,5-triol |
| Nih Violation | False |
| Class | Organooxygen compounds |
| Xlogp | -1.6 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Alcohols and polyols |
| Molecular Formula | C6H10O5 |
| Inchi Key | FSOIXBFBUZWTMV-KVQBGUIXSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | Lichenan |
| Compound Name | (2R,3R,4R)-2-methoxy-3,4-dihydro-2H-pyran-3,4,5-triol |
| Kingdom | Organic compounds |
| Exact Mass | 162.053 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 162.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 162.14 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Inchi | InChI=1S/C6H10O5/c1-10-6-5(9)4(8)3(7)2-11-6/h2,4-9H,1H3/t4-,5+,6+/m0/s1 |
| Smiles | CO[C@H]1[C@@H]([C@H](C(=CO1)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | 1,2-diols |
- 1. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:fooddb_chem_all