beta-D-glucosamine
PubChem CID: 441477
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | beta-D-Glucosamine, 14257-69-3, 2-Amino-2-deoxy-beta-D-glucopyranose, (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol, beta-Glucosamine, Glucosamine, beta-D, beta-Glucosamine, d-, beta-D-Glucopyranose, 2-amino-2-deoxy-, CHEBI:28393, 58L064K8RR, .BETA.-GLUCOSAMINE, .BETA.-D-GLUCOSAMINE, 90-77-7, GLUCOSAMINE, .BETA.-D, GLUCOSAMINE .BETA.-FORM, .BETA.-GLUCOSAMINE, D-, GLUCOSAMINE .BETA.-FORM [MI], C08349, glucosamin, .BETA.-D-GLUCOPYRANOSE, 2-AMINO-2-DEOXY-, GCS, D-Glucopyranose, 2-deoxy-2-Amino-, WURCS=2.0/1,1,0/(a2122h-1b_1-5_2*N)/1/, WURCS=2.0/1,1,0/[a2122h-1b_1-5_2*N]/1/, UNII-58L064K8RR, 3h-glucosamine, D-beta-glucosamine, Spectrum_000831, Spectrum2_000519, Spectrum3_000443, Spectrum4_000565, Spectrum5_000756, SCHEMBL3263, GLUCOSAMINE BETA-FORM, BSPBio_002086, KBioGR_000970, KBioSS_001311, DivK1c_000261, SPBio_000477, CHEMBL234432, GTPL4535, [4)-beta-D-GlcpN(1->]n, CHEBI:16261, HMS500N03, KBio1_000261, KBio2_001311, KBio2_003879, KBio2_006447, KBio3_001306, MSWZFWKMSRAUBD-QZABAPFNSA-, NINDS_000261, DTXSID601347914, AKOS006277722, IDI1_000261, NCGC00164421-01, NCGC00178826-01, (1->4)-2-amino-2-deoxy-beta-D-glucan, SBI-0051394.P003, NS00010536, AB00053477_02, BRD-K29918010-003-04-1, Q27077039, (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)tetrahydropyran-2,4,5-triol, (2R,3R,4R,5S,6R)-3-Amino-6-(hydroxymethyl)tetrahydro-2H-pyran-2,4,5-triol, InChI=1/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1 |
|---|---|
| Topological Polar Surface Area | 116.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Heavy Atom Count | 12.0 |
| Description | Glucosamine is an amino sugar and a prominent precursor in the biochemical synthesis of glycosylated proteins and lipids. Glucosamine is part of the structure of the polysaccharides chitosan and chitin, which compose the exoskeletons of crustaceans and other arthropods, cell walls in fungi and many higher organisms. In the US it is one of the most common non-vitamin, non-mineral, dietary supplements used by adults. beta-D-Glucosamine is found in common bean, yellow wax bean, and green bean. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 155.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol |
| Nih Violation | False |
| Class | Carbohydrates and carbohydrate conjugates |
| Xlogp | -2.8 |
| Superclass | Organooxygen compounds |
| Is Pains | False |
| Subclass | Aminosaccharides |
| Molecular Formula | C6H13NO5 |
| Inchi Key | MSWZFWKMSRAUBD-QZABAPFNSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | 2-Amino-2-deoxy-beta-D-glucopyranose, b-D-Glucosamine, beta-D-Glucosamine, β-D-glucosamine, D-GLUCOSAMINE, WURCS=2.0/1,1,0/[a2122h-1b_1-5_2*n]/1/, Β-D-glucosamine, 2-amino-2-Deoxy-beta-D-glucopyranose, 2 Amino 2 deoxyglucose, Dona S, Glucosamine sulfate, Dona, Hespercorbin, Xicil, 2-Amino-2-deoxyglucose, Glucosamine, Sulfate, glucosamine |
| Substituent Name | Glucosamine, Amino sugar, Oxane, Monosaccharide, Secondary alcohol, Polyol, Hemiacetal, 1,2-diol, 1,2-aminoalcohol, Oxacycle, Organoheterocyclic compound, Ether, Hydrocarbon derivative, Primary amine, Primary alcohol, Organonitrogen compound, Primary aliphatic amine, Amine, Alcohol, Aliphatic heteromonocyclic compound |
| Compound Name | beta-D-glucosamine |
| Kingdom | Organic compounds |
| Exact Mass | 179.079 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 179.079 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 179.17 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Inchi | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1 |
| Smiles | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)N)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Hexoses |
- 1. Outgoing r'ship
FOUND_INto/from Phaseolus Vulgaris (Plant) Rel Props:Source_db:fooddb_chem_all