beta-D-glucosamine
PubChem CID: 441477
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | beta-D-Glucosamine, 14257-69-3, 2-Amino-2-deoxy-beta-D-glucopyranose, (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol, beta-Glucosamine, Glucosamine, beta-D, beta-Glucosamine, d-, beta-D-Glucopyranose, 2-amino-2-deoxy-, CHEBI:28393, 58L064K8RR, .BETA.-GLUCOSAMINE, .BETA.-D-GLUCOSAMINE, 90-77-7, GLUCOSAMINE, .BETA.-D, GLUCOSAMINE .BETA.-FORM, .BETA.-GLUCOSAMINE, D-, GLUCOSAMINE .BETA.-FORM [MI], C08349, glucosamin, .BETA.-D-GLUCOPYRANOSE, 2-AMINO-2-DEOXY-, GCS, D-Glucopyranose, 2-deoxy-2-Amino-, WURCS=2.0/1,1,0/(a2122h-1b_1-5_2*N)/1/, WURCS=2.0/1,1,0/[a2122h-1b_1-5_2*N]/1/, UNII-58L064K8RR, 3h-glucosamine, D-beta-glucosamine, Spectrum_000831, Spectrum2_000519, Spectrum3_000443, Spectrum4_000565, Spectrum5_000756, SCHEMBL3263, GLUCOSAMINE BETA-FORM, BSPBio_002086, KBioGR_000970, KBioSS_001311, DivK1c_000261, SPBio_000477, CHEMBL234432, GTPL4535, [4)-beta-D-GlcpN(1->]n, CHEBI:16261, HMS500N03, KBio1_000261, KBio2_001311, KBio2_003879, KBio2_006447, KBio3_001306, MSWZFWKMSRAUBD-QZABAPFNSA-, NINDS_000261, DTXSID601347914, AKOS006277722, IDI1_000261, NCGC00164421-01, NCGC00178826-01, (1->4)-2-amino-2-deoxy-beta-D-glucan, SBI-0051394.P003, NS00010536, AB00053477_02, BRD-K29918010-003-04-1, Q27077039, (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)tetrahydropyran-2,4,5-triol, (2R,3R,4R,5S,6R)-3-Amino-6-(hydroxymethyl)tetrahydro-2H-pyran-2,4,5-triol, InChI=1/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1 |
|---|---|
| Topological Polar Surface Area | 116.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | MSWZFWKMSRAUBD-QZABAPFNSA-N |
| Rotatable Bond Count | 1.0 |
| Substituent Name | Glucosamine, Amino sugar, Oxane, Monosaccharide, Secondary alcohol, Polyol, Hemiacetal, 1,2-diol, 1,2-aminoalcohol, Oxacycle, Organoheterocyclic compound, Ether, Hydrocarbon derivative, Primary amine, Primary alcohol, Organonitrogen compound, Primary aliphatic amine, Amine, Alcohol, Aliphatic heteromonocyclic compound |
| Synonyms | 2-Amino-2-deoxy-beta-D-glucopyranose, b-D-Glucosamine, beta-D-Glucosamine, β-D-glucosamine, D-GLUCOSAMINE, WURCS=2.0/1,1,0/[a2122h-1b_1-5_2*n]/1/, Β-D-glucosamine, 2-amino-2-Deoxy-beta-D-glucopyranose, 2 Amino 2 deoxyglucose, Dona S, Glucosamine sulfate, Dona, Hespercorbin, Xicil, 2-Amino-2-deoxyglucose, Glucosamine, Sulfate, glucosamine |
| Heavy Atom Count | 12.0 |
| Compound Name | beta-D-glucosamine |
| Kingdom | Organic compounds |
| Description | Glucosamine is an amino sugar and a prominent precursor in the biochemical synthesis of glycosylated proteins and lipids. Glucosamine is part of the structure of the polysaccharides chitosan and chitin, which compose the exoskeletons of crustaceans and other arthropods, cell walls in fungi and many higher organisms. In the US it is one of the most common non-vitamin, non-mineral, dietary supplements used by adults. beta-D-Glucosamine is found in common bean, yellow wax bean, and green bean. |
| Exact Mass | 179.079 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 179.079 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 155.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 179.17 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol |
| Total Atom Stereocenter Count | 5.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Carbohydrates and carbohydrate conjugates |
| Inchi | InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1 |
| Smiles | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)N)O)O)O |
| Xlogp | -2.8 |
| Superclass | Organooxygen compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Aminosaccharides |
| Taxonomy Direct Parent | Hexoses |
| Molecular Formula | C6H13NO5 |
- 1. Outgoing r'ship
FOUND_INto/from Phaseolus Vulgaris (Plant) Rel Props:Source_db:fooddb_chem_all