6-O-(6-Deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose
PubChem CID: 441429
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose, 6-O-alpha-L-rhamnopyranosyl-D-glucose, alpha-L-rhamnopyranosyl-(1->6)-D-glucose, 26184-96-3, (2R,3R,4S,5S,6R)-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol, (2R,3R,4S,5S,6R)-6-(((2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl)oxane-2,3,4,5-tetrol, SCHEMBL117741, DTXSID401226338, (2R,3R,4S,5S,6R)-6-({[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}methyl)oxane-2,3,4,5-tetrol, AKOS040734113, DB-231743, C08247, 6-O-alpha-l-rhamnopyranosyl-beta-d-glucopyranose, Q259374, 6-O-(6-Deoxy-I+/--L-mannopyranosyl)-I(2)-D-glucopyranose |
|---|---|
| Topological Polar Surface Area | 169.0 |
| Hydrogen Bond Donor Count | 7.0 |
| Inchi Key | OVVGHDNPYGTYIT-BNXXONSGSA-N |
| Rotatable Bond Count | 3.0 |
| Synonyms | Rutinose |
| Heavy Atom Count | 22.0 |
| Compound Name | 6-O-(6-Deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranose |
| Description | Rutinose, also known as 6-O-(6-deoxy-alpha-L-mannopyranosyl)-D-glucose or (&alpha, -rhamnopyranosyl-&beta, -glucopyranose, is a member of the class of compounds known as O-glycosyl compounds. O-glycosyl compounds are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. Rutinose is soluble (in water) and a very weakly acidic compound (based on its pKa). Rutinose can be found in capers, which makes rutinose a potential biomarker for the consumption of this food product. |
| Exact Mass | 326.121 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 326.121 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 368.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 326.3 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | (2R,3R,4S,5S,6R)-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C12H22O10/c1-3-5(13)7(15)10(18)12(21-3)20-2-4-6(14)8(16)9(17)11(19)22-4/h3-19H,2H2,1H3/t3-,4+,5-,6+,7+,8-,9+,10+,11+,12+/m0/s1 |
| Smiles | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)O)O)O)O)O)O |
| Xlogp | -4.2 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C12H22O10 |
- 1. Outgoing r'ship
FOUND_INto/from Capparis Spinosa (Plant) Rel Props:Source_db:fooddb_chem_all