D-Fructose, 6-(dihydrogen phosphate)
PubChem CID: 440641
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | beta-D-Fructose 6-phosphate, beta-D-fructofuranose 6-phosphate, 6-O-phosphono-beta-D-fructofuranose, [(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl dihydrogen phosphate, CHEBI:16084, DTXSID90889361, 113181-03-6, (1R,4S)-(S)-Bicalutamide Sulfide Camphanic Acid Ester, F6P, 1mto, SCHEMBL8056, CHEMBL604196, DTXCID201028623, [1R-[1alpha(S*),4beta]]-4,7,7-Trimethyl-3-oxo-1-[[[4-cyano-3-(trifluoromethyl)phenyl]amino]carbonyl]-2-[(4-fluorophenyl)thio]-1-methylethyl Ester 2-Oxabicyclo[2.2.1]heptane-1-carboxylic Acid, NS00015225, beta-D-fructofuranose 6-(dihydrogen phosphate), C05345, Q27098371, {[(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxy}phosphonic acid |
|---|---|
| Topological Polar Surface Area | 157.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Heavy Atom Count | 16.0 |
| Pathway Kegg Map Id | map00500 |
| Description | Beta-D-Fructose 6 phosphate (b-F6P) is the beta-anomer of fructose-6-phosphate. There are two anomers of fructose 6 phosphate, the alpha anomer and the beta anomer. Specifically, beta-D-fructose 6-phosphate is fructose sugar phosphorylated on carbon 6. Beta-D-Fructose 6-phosphate is a substrate for Fructose-1,6-bisphosphatase, Pyruvate kinase (isozymes R/L), Hexokinase (type I), Fructose-bisphosphate aldolase A, L-lactate dehydrogenase B chain, Glyceraldehyde-3-phosphate dehydrogenase (liver) and Transaldolase. [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 290.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Enzyme Uniprot Id | P35557, P52790, P52789, P19367, Q16875, Q16877, P16118, O00757, P37837, O60825, P06744 |
| Uniprot Id | P10323 |
| Iupac Name | [(2R,3S,4S,5R)-3,4,5-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl dihydrogen phosphate |
| Prediction Hob | 0.0 |
| Xlogp | -3.9 |
| Molecular Formula | C6H13O9P |
| Prediction Swissadme | 0.0 |
| Inchi Key | BGWGXPAPYGQALX-ARQDHWQXSA-N |
| Fcsp3 | 1.0 |
| Logs | -0.094 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Logd | -1.509 |
| Synonyms | 6-O-ONO-b-D-Fructofuranose, 6-O-ONO-beta-D-Fructofuranose, 6-O-ONO-β-D-fructofuranose, b-D-Fructose 6-ate, b-D-Fructose 6-ic acid, beta-D-Fructose 6-ate, beta-D-Fructose 6-ic acid, beta-D-Fructose 6-phosphate, beta-D-Fructose 6-phosphic acid, β-D-fructose 6-ate, β-D-fructose 6-ic acid |
| Compound Name | D-Fructose, 6-(dihydrogen phosphate) |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 260.03 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 260.03 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 260.14 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 1.2870630000000005 |
| Inchi | InChI=1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6-/m1/s1 |
| Smiles | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O)OP(=O)(O)O |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Chlamydomonas Reinhardtii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all