N6,N6,N6-Trimethyl-L-lysine
PubChem CID: 440120
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | N6,N6,N6-Trimethyl-L-lysine, N-EPSILON,N-EPSILON,N-EPSILON-TRIMETHYLLYSINE, (2S)-2-amino-6-(trimethylazaniumyl)hexanoate, 23284-33-5, (S)-2-amino-6-(trimethylammonio)hexanoate, (S)-2-amino-6-(trimethylammonio)hexanoic acid, N(6),N(6),N(6)-trimethyl-L-lysine, delta-trimethyllysine, N-6-Trimethyllysine, SCHEMBL21225578, CHEBI:165870, AKOS006272412, AT43362, C03793, S)-5-amino-5-carboxy-N,N,N-trimethyl-1-pentanaminium |
|---|---|
| Topological Polar Surface Area | 66.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 13.0 |
| Description | N6,N6,N6-Trimethyl-L-lysine is a methylated derivative of the amino acid lysine. It is a component of histone proteins, a precursor of carnitine and a coenzyme of fatty acid oxidation. N6,N6,N6-Trimethyl-L-lysine residues are found in a number of proteins and are generated by the action of S-adenosyl-L-methionine on exposed lysine residues. When trimethyllysine is released from cognate proteins via proteolysis, it serves as a precursor for carnitine biosynthesis. Mitochondrial 6-N-trimethyllysine dioxygenase converts 6-N-trimethyllysine to 3-hydroxy-6-N-trimethyllysine as the first step for carnitine biosynthesis. Because the subsequent carnitine biosynthesis enzymes are cytosolic, 3-hydroxy-6-N-trimethyllysine must be transported out of the mitochondria by a putative mitochondrial 6-N-trimethyllysine/3-hydroxy-6-N-trimethyllysine transporter system. Plasma -N-trimethyllysine concentrations are significantly lower in systemic carnitine deficiency patients compared to normal individuals, but no significant difference in urinary -N-trimethyllysine excretion is seen between the two groups. [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 158.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Enzyme Uniprot Id | Q9Y6A9 |
| Iupac Name | (2S)-2-amino-6-(trimethylazaniumyl)hexanoate |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Xlogp | -1.6 |
| Is Pains | False |
| Molecular Formula | C9H20N2O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | MXNRLFUSFKVQSK-QMMMGPOBSA-N |
| Fcsp3 | 0.8888888888888888 |
| Logs | -0.159 |
| Rotatable Bond Count | 5.0 |
| State | Solid |
| Logd | -2.719 |
| Synonyms | (S)-2-amino-6-(trimethylammonio)hexanoate, (S)-2-amino-6-(trimethylammonio)hexanoic acid, delta-trimethyllysine, epsilon-N-trimethyl-L-lysine, epsilon-trimethyl-L-lysine, N(6),N(6),N(6)-trimethyl-L-lysine, N6,N6,N6-trimethyl-L-lysine, S)-5-amino-5-carboxy-N,N,N-trimethyl-1-pentanaminium, trimethyllysine |
| Compound Name | N6,N6,N6-Trimethyl-L-lysine |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 188.152 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 188.152 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 188.27 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 0.2455198000000004 |
| Inchi | InChI=1S/C9H20N2O2/c1-11(2,3)7-5-4-6-8(10)9(12)13/h8H,4-7,10H2,1-3H3/t8-/m0/s1 |
| Smiles | C[N+](C)(C)CCCC[C@@H](C(=O)[O-])N |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Conyza Filaginoides (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Lactuca Virosa (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Lamium Amplexicaule (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Onychium Japonicum (Plant) Rel Props:Source_db:cmaup_ingredients