L-sorbose 1-phosphate
PubChem CID: 439837
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | L-sorbose 1-phosphate, Sorbose 1-phosphate, L-Sorbose 1P, L-xylo-Hexulose 1-phosphate, CHEBI:38342, [(3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexyl] dihydrogen phosphate, L-sorbose 1-(dihydrogen phosphate), (3S,4R,5S)-3,4,5,6-Tetrahydroxy-2-oxohexyl dihydrogen phosphate, {[(3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexyl]oxy}phosphonic acid, 49594-02-7, (((3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexyl)oxy)phosphonic acid, ((3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexyl) dihydrogen phosphate, 1-O-phosphonosorbose, L-Sorbose-1-phosphat, 1-O-phosphono-L-sorbose, Sorbose 1-phosphoric acid, L-Sorbose 1-phosphoric acid, SCHEMBL9738422, CHEBI:28173, sorbose 1-(dihydrogen phosphate), L-Xylo-hexulose 1-phosphoric acid, xylo-hex-2-ulose 1-(dihydrogen phosphate), L-xylo-hex-2-ulose 1-(dihydrogen phosphate), C02888, L-Xylo-hex-2-ulose 1-(dihydrogen phosphoric acid), Q27117458 |
|---|---|
| Topological Polar Surface Area | 165.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Heavy Atom Count | 16.0 |
| Description | Sorbose 1-phosphate is formed when extracellular sorbose is taken into the cell. The enzyme responsible for this is PTS-Sor-EIIA [EC:2.7.1.69]. [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 273.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | [(3S,4R,5S)-3,4,5,6-tetrahydroxy-2-oxohexyl] dihydrogen phosphate |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Xlogp | -4.3 |
| Is Pains | False |
| Molecular Formula | C6H13O9P |
| Prediction Swissadme | 0.0 |
| Inchi Key | ZKLLSNQJRLJIGT-OTWZMJIISA-N |
| Fcsp3 | 0.8333333333333334 |
| Rotatable Bond Count | 7.0 |
| State | Solid |
| Synonyms | 1-O-ONO-L-Sorbose, L-Sorbose 1-ate, L-Sorbose 1-ic acid, L-Sorbose 1-phosphate, L-Sorbose 1P, L-xylo-Hex-2-ulose 1-(dihydrogen ate), L-xylo-Hex-2-ulose 1-(dihydrogen ic acid), L-xylo-Hexulose 1-ate, L-xylo-Hexulose 1-ic acid, L-xylo-Hexulose 1-phosphate |
| Compound Name | L-sorbose 1-phosphate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 260.03 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 260.03 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 260.14 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 1.7433630000000002 |
| Inchi | InChI=1S/C6H13O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3,5-8,10-11H,1-2H2,(H2,12,13,14)/t3-,5+,6+/m0/s1 |
| Smiles | C([C@@H]([C@H]([C@@H](C(=O)COP(=O)(O)O)O)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Chlamydomonas Reinhardtii (Plant) Rel Props:Source_db:cmaup_ingredients