beta-L-Arabinopyranose
PubChem CID: 439764
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | beta-L-Arabinose, beta-L-Arabinopyranose, 7296-56-2, .beta.-L-Arabinopyranose, (2S,3R,4S,5S)-oxane-2,3,4,5-tetrol, b-L-Arabinopyranose, Arabinopyranose, beta-L-, 194RG7YBRS, Arabinopyranose, .beta.-L-, .BETA.-L-ARABINOSE, CHEBI:40886, DTXSID201315644, L(+)-Arabinose, (2S,3R,4S,5S)-tetrahydro-2H-pyran-2,3,4,5-tetraol, 87-72-9, Pentopyranose #, ARB, UNII-194RG7YBRS, WURCS=2.0/1,1,0/(a211h-1b_1-5)/1/, WURCS=2.0/1,1,0/[a211h-1b_1-5]/1/, 1bap, 3tb6, beta-L-(+)-Arabinose, I(2)-L-Arabinopyranose, bmse000213, SCHEMBL4430971, SRBFZHDQGSBBOR-KLVWXMOXSA-N, DTXCID001745542, MFCD00067709, s3986, AKOS025402335, AC-8171, CCG-266201, NCGC00160355-01, C02479, Q27120409, F0F57802-D37D-4858-8FE9-F695304211C1 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 90.2 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Monosaccharides |
| Deep Smiles | O[C@H]CO[C@@H][C@@H][C@H]6O))O))O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | C1CCOCC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 117.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Uniprot Id | P15121, O60218 |
| Iupac Name | (2S,3R,4S,5S)-oxane-2,3,4,5-tetrol |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Organooxygen compounds |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -2.5 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H10O5 |
| Scaffold Graph Node Bond Level | C1CCOCC1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | SRBFZHDQGSBBOR-KLVWXMOXSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 1.0 |
| Logs | 0.176 |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Logd | -1.777 |
| Synonyms | BETA-L-ARABINOSE, WURCS=2.0/1,1,0/[a211h-1b_1-5]/1/, b-L-ARABINOSE, Β-L-arabinose, b-L-Arabinopyranose, Β-L-arabinopyranose, L-Arabinopyranose, Pectinose, beta-L-Arabinopyranose, Arabinopyranose, Arabinose, L-Arabinose, 3-(beta-l-arabopyranoside)-l-arabinose, 3-o-beta-l-arabinopyranosyl-l-arabinose |
| Esol Class | Highly soluble |
| Functional Groups | CO, CO[C@@H](C)O |
| Compound Name | beta-L-Arabinopyranose |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 150.053 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 150.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 150.13 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | 1.1317940000000002 |
| Inchi | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5-/m0/s1 |
| Smiles | C1[C@@H]([C@@H]([C@H]([C@H](O1)O)O)O)O |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Taxonomy Direct Parent | Pentoses |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Catechu (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 2. Outgoing r'ship
FOUND_INto/from Acacia Nilotica (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 3. Outgoing r'ship
FOUND_INto/from Grazielia Serrata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Strychnos Tomentosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all