Amylodextrin
PubChem CID: 439341
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | alpha-Maltose, maltose, Amylodextrin, 4482-75-1, Thyodene, 9005-84-9, Glcalpha1-4Glca, Glcalpha1-4Glcalpha, alpha-D-Glucopyranose, 4-o-alpha-D-glucopyranosyl-, EINECS 232-686-4, 15SUG9AD26, (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol, Maltose solution, 20% in H2O, alpha-D-Glcp-(1->4)-alpha-D-Glcp, D-(+)-Maltose, maltodextrin, 4-O-alpha-D-glucopyranosyl-alpha-D-glucopyranose, (2S,3R,4R,5S,6R)-6-(Hydroxymethyl)-5-(((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2,3,4-triol, alpha-D-glucopyranosyl-(1->4)-alpha-D-glucopyranose, Starch from potato, MFCD00082026, 4-O-alpha-D-Glucopyranosyl-D-glucose, Maltose, alpha-, Maltose alpha-anomer, Maltose, .alpha.-, CHEBI:18167, UNII-15SUG9AD26, aAmylodextrin, Amylodextrins, Starkelosung, Amylogen, 1anf, 1urg, Glca1-4Glca, IODINE INDICATOR, 1n3w, 1r6z, 2d2v, .ALPHA.-MALTOSE, SCHEMBL346806, MALTOSE .ALPHA.-ANOMER, .alpha.-D-Glucopyranose, 4-O-.alpha.-D-glucopyranosyl-, BDBM23407, CHEBI:84395, HY-N2024B, DTXSID20196313, DTXSID801009841, HY-N2024, MFCD00132834, AKOS015896501, AT42487, CS-W019624, STARCH, SOLUBLE (IODINE INDICATOR), CS-0226092, NS00069761, C00897, G72120, Q26914016, (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol, 232-686-4 |
|---|---|
| Topological Polar Surface Area | 190.0 |
| Hydrogen Bond Donor Count | 8.0 |
| Heavy Atom Count | 23.0 |
| Description | Nonsweet nutritive food additive used as a reduced calorie fat replacementand is) also used as a stabiliser, thickener and encapsulating agent in food products Maltodextrin is a polysaccharide that is used as a food additive. It is hydrolysate produced from starch and is usually found as a creamy-white hygroscopic spraydried powder. Maltodextrin is easily digestible, being absorbed as rapidly as glucose, and might be either moderately sweet or almost flavorless. Maltodextrin is found in many foods, some of which are yellow pond-lily, pecan nut, tea, and celery leaves. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 382.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 10.0 |
| Iupac Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Carbohydrates and carbohydrate conjugates |
| Xlogp | -4.7 |
| Superclass | Organooxygen compounds |
| Is Pains | False |
| Subclass | Glycosyl compounds |
| Molecular Formula | C12H22O11 |
| Prediction Swissadme | 0.0 |
| Inchi Key | GUBGYTABKSRVRQ-ASMJPISFSA-N |
| Fcsp3 | 1.0 |
| Logs | -0.203 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Logd | -3.029 |
| Synonyms | 4-O-a-D-Glucopyranosyl-a-D-glucopyranose, 4-O-alpha-D-Glucopyranosyl-alpha-D-glucopyranose, 4-O-α-D-glucopyranosyl-α-D-glucopyranose, a-D-Glcp-(1->4)-a-D-glcp, a-Malt sugar, a-Maltose, alpha-D-Glcp-(1->4)-alpha-D-glcp, alpha-Maltose, Glcalpha1-4glca, Glcalpha1-4glcalpha, Linear maltodextrin, Maltodextrin, Maltodextrin(n-2), Maltodextrin(n), MALTOSE, α-D-glcp-(1->4)-α-D-glcp, α-malt sugar, α-maltose, alpha-D-GLCP-(1->4)-alpha-D-GLCP, alpha-Malt sugar, Glca1-4glca, 4-O-Α-D-glucopyranosyl-α-D-glucopyranose, a-D-GLCP-(1->4)-a-D-GLCP, Α-D-GLCP-(1->4)-α-D-GLCP, Α-malt sugar, Maltodextrin(N), Maltodextrin(N-2) |
| Substituent Name | O-glycosyl compound, Disaccharide, Oxane, Secondary alcohol, Polyol, Hemiacetal, 1,2-diol, Oxacycle, Organoheterocyclic compound, Ether, Acetal, Hydrocarbon derivative, Primary alcohol, Alcohol, Aliphatic heteromonocyclic compound |
| Compound Name | Amylodextrin |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 342.116 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 342.116 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 342.3 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Esol | 0.5508586 |
| Inchi | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
| Smiles | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O |
| Nring | 2.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | O-glycosyl compounds |
- 1. Outgoing r'ship
FOUND_INto/from Alstonia Muelleriana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Artemisia Cina (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Coreopsis Nodosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Dacrydium Cupressinum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Fagopyrum Esculentum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Glycine Tomentella (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Haematococcus Lacustris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Nicotiana Undulata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Panax Schinseng (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Passiflora Incarnata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Pogostemon Cablin (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Senecio Paludaffinis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Trigonella Grandiflora (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Tripolium Pannonicum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Uvaria Calamistrata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all