L-Arabinose
PubChem CID: 439195
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | L-ARABINOPYRANOSE, L-arabinose, arabinose, Arabinopyranose, arabinopyranoside, L-Arabinopyranoside, L-Ara, ARA, 87-72-9, L(+)-Arabinose, CHEBI:17535, (3R,4S,5S)-oxane-2,3,4,5-tetrol, EINECS 201-767-6, (3R,4S,5S)-Tetrahydro-2H-pyran-2,3,4,5-tetraol, (3R,4S,5S)-Tetrahydropyran-2,3,4,5-tetrol, L-Arabinopyranose, L-Arabinose, Arabinose l-form, DTXSID5052836, MFCD00006609, L-arabino-pentose, Arabinose, L-(VAN), SCHEMBL359263, CHEMBL1357418, DTXCID7019733, DTXCID7031379, CHEBI:30849, SRBFZHDQGSBBOR-HWQSCIPKSA-N, AKOS006240450, MA02043, NCGC00166074-01, AC-14130, AS-39893, NS00078898, C00259, Q27102447, E0E89A5B-75E5-437B-953E-16E75EE7AEF2, WURCS=2.0/1,1,0/(a211h-1x_1-5)/1/, (+)-Arabinose, L-(+)-Arabinose, Arabinose, Arabinopyranose, 201-767-6, 226-214-6 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 90.2 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Monosaccharides |
| Deep Smiles | O[C@H]COC[C@@H][C@H]6O))O))O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Organooxygen compounds |
| Scaffold Graph Node Level | C1CCOCC1 |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 117.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Uniprot Id | P10323, P27695 |
| Iupac Name | (3R,4S,5S)-oxane-2,3,4,5-tetrol |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -2.5 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H10O5 |
| Scaffold Graph Node Bond Level | C1CCOCC1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | SRBFZHDQGSBBOR-HWQSCIPKSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 1.0 |
| Logs | 0.171 |
| Rotatable Bond Count | 0.0 |
| Logd | -1.974 |
| Synonyms | l(+)-arabinose, l-arabinose |
| Esol Class | Highly soluble |
| Functional Groups | CO, COC(C)O |
| Compound Name | L-Arabinose |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 150.053 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 150.053 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 150.13 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | 1.1317940000000002 |
| Inchi | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5?/m0/s1 |
| Smiles | C1[C@@H]([C@@H]([C@H](C(O1)O)O)O)O |
| Nring | 1.0 |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Auriculiformis (Plant) Rel Props:Reference:ISBN:9770972795006; ISBN:9788172362089 - 2. Outgoing r'ship
FOUND_INto/from Acacia Catechu (Plant) Rel Props:Reference:ISBN:9788172363178 - 3. Outgoing r'ship
FOUND_INto/from Acacia Chundra (Plant) Rel Props:Reference:ISBN:9770972795006 - 4. Outgoing r'ship
FOUND_INto/from Acacia Nilotica (Plant) Rel Props:Reference:ISBN:9780387706375; ISBN:9788172363178 - 5. Outgoing r'ship
FOUND_INto/from Aegle Marmelos (Plant) Rel Props:Reference:ISBN:9770972795006 - 6. Outgoing r'ship
FOUND_INto/from Albizia Lebbeck (Plant) Rel Props:Reference:ISBN:9770972795006 - 7. Outgoing r'ship
FOUND_INto/from Albizia Procera (Plant) Rel Props:Reference:ISBN:9770972795006 - 8. Outgoing r'ship
FOUND_INto/from Allium Chinense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Allium Macrostemon (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Aloe Africana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Aloe Barbadensis (Plant) Rel Props:Source_db:npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Aloe Ferox (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Aloe Spicata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Aloe Vera (Plant) Rel Props:Source_db:cmaup_ingredients - 15. Outgoing r'ship
FOUND_INto/from Althaea Officinalis (Plant) Rel Props:Reference:ISBN:9788185042084 - 16. Outgoing r'ship
FOUND_INto/from Anogeissus Latifolia (Plant) Rel Props:Reference:ISBN:9788172360818 - 17. Outgoing r'ship
FOUND_INto/from Araucaria Columnaris (Plant) Rel Props:Reference:ISBN:9770972795006 - 18. Outgoing r'ship
FOUND_INto/from Azadirachta Indica (Plant) Rel Props:Reference:ISBN:9788172362089 - 19. Outgoing r'ship
FOUND_INto/from Boerhavia Diffusa (Plant) Rel Props:Reference:ISBN:9788185042084 - 20. Outgoing r'ship
FOUND_INto/from Bombax Ceiba (Plant) Rel Props:Reference:ISBN:9770972795006 - 21. Outgoing r'ship
FOUND_INto/from Brasenia Schreberi (Plant) Rel Props:Reference:ISBN:9788172362089 - 22. Outgoing r'ship
FOUND_INto/from Brassica Rapa (Plant) Rel Props:Reference:ISBN:9788185042084 - 23. Outgoing r'ship
FOUND_INto/from Carica Papaya (Plant) Rel Props:Reference:ISBN:9770972795006 - 24. Outgoing r'ship
FOUND_INto/from Clitoria Mariana (Plant) Rel Props:Reference:ISBN:9770972795006 - 25. Outgoing r'ship
FOUND_INto/from Commelina Communis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 26. Outgoing r'ship
FOUND_INto/from Lallemantia Royleana (Plant) Rel Props:Reference:ISBN:9788172361792 - 27. Outgoing r'ship
FOUND_INto/from Lepidium Sativum (Plant) Rel Props:Reference:ISBN:9780387706375 - 28. Outgoing r'ship
FOUND_INto/from Linum Usitatissimum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 29. Outgoing r'ship
FOUND_INto/from Madhuca Longifolia (Plant) Rel Props:Reference:ISBN:9788172361150 - 30. Outgoing r'ship
FOUND_INto/from Mimusops Elengi (Plant) Rel Props:Reference:ISBN:9788172361150 - 31. Outgoing r'ship
FOUND_INto/from Nymphaea Nouchali (Plant) Rel Props:Reference:ISBN:9788172362461 - 32. Outgoing r'ship
FOUND_INto/from Pastinaca Sativa (Plant) Rel Props:Reference:ISBN:9788172362461 - 33. Outgoing r'ship
FOUND_INto/from Plantago Lanceolata (Plant) Rel Props:Reference:ISBN:9780387706375 - 34. Outgoing r'ship
FOUND_INto/from Plantago Major (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 35. Outgoing r'ship
FOUND_INto/from Salvia Aegyptiaca (Plant) Rel Props:Reference:ISBN:9780387706375 - 36. Outgoing r'ship
FOUND_INto/from Tamarindus Indica (Plant) Rel Props:Reference:ISBN:9780387706375 - 37. Outgoing r'ship
FOUND_INto/from Terminalia Alata (Plant) Rel Props:Reference:ISBN:9788172360818 - 38. Outgoing r'ship
FOUND_INto/from Vallisneria Spiralis (Plant) Rel Props:Reference:ISBN:9780387706375; ISBN:9788172362140 - 39. Outgoing r'ship
FOUND_INto/from Vitis Vinifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 40. Outgoing r'ship
FOUND_INto/from Ziziphus Jujuba (Plant) Rel Props:Reference:ISBN:9788172360818