D-ribofuranose 5-phosphate
PubChem CID: 439167
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D-ribofuranose 5-phosphate, 93-87-8, bmse000204, d-ribofuranose 5-O-phosphate, SCHEMBL708955, CHEBI:52742, DTXSID101273647, D-ribofuranose 5-(dihydrogen phosphate), NS00015097, C00117, Q27123582, {[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methoxy}phosphonic acid, D-ribofuranose 5-phosphate (closed ring structure, partial stereochemistry) |
|---|---|
| Topological Polar Surface Area | 137.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | KTVPXOYAKDPRHY-SOOFDHNKSA-N |
| Rotatable Bond Count | 3.0 |
| Synonyms | 5-O-phosphono-D-ribose, D-Ribofuranose 5-phosphate, D-ribofuranose, 5-(dihydrogen phosphate), D-Ribose 5-(dihydrogen phosphate), D-Ribose 5-phosphic acid, D-ribose-5-phosphate, D-ribose-5-phosphorate, D-ribose-5-phosphoric acid |
| Heavy Atom Count | 14.0 |
| Compound Name | D-ribofuranose 5-phosphate |
| Description | D-Ribose 5-phosphate is an important intermediate metabolite in the Pentose phosphate pathway (KEGG, map00030) and in the Purine metabolism pathway (KEGG, map00230)., The intracellular ribose 5-phosphate concentration is an important determinant of the rate of de novo purine synthesis. (PMID 6699001). D-Ribose 5-phosphate is found in rice. |
| Exact Mass | 230.019 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 230.019 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 238.0 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 230.11 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C5H11O8P/c6-3-2(1-12-14(9,10)11)13-5(8)4(3)7/h2-8H,1H2,(H2,9,10,11)/t2-,3-,4-,5?/m1/s1 |
| Smiles | C([C@@H]1[C@H]([C@H](C(O1)O)O)O)OP(=O)(O)O |
| Xlogp | -3.6 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C5H11O8P |
- 1. Outgoing r'ship
FOUND_INto/from Oryza Sativa (Plant) Rel Props:Source_db:fooddb_chem_all