Solamarin, beta
PubChem CID: 437080
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | SOLAMARIN, BETA, .beta.-Solamarine, 2-[4-hydroxy-2-(hydroxymethyl)-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol, NSC94735, NSC407810, CHEMBL2005327, SCHEMBL25775453, BCP18605, Solamargin, (c)(1/2)-Solanigrine, LS-15468, BRD-A65562236-001-01-2, Spirosol-5-en-3-yl 2,4-bis-O-(6-deoxyhexopyranosyl)hexopyranoside, 2-[4-hydroxy-2-(hydroxymethyl)-6-(5'-tetramethylspiro[[?]-2,2'-piperidine]yl)oxy-5-(3,4,5-trihydroxy-6-methyl-tetrahydropyran-2-yl)oxy-tetrahydropyran-3-yl]oxy-6-methyl-tetrahydropyran-3,4,5-triol |
|---|---|
| Topological Polar Surface Area | 238.0 |
| Hydrogen Bond Donor Count | 9.0 |
| Heavy Atom Count | 61.0 |
| Description | Solamargine, also known as beta-solamarine, is a member of the class of compounds known as steroidal saponins. Steroidal saponins are saponins in which the aglycone moiety is a steroid. The steroidal aglycone is usually a spirostane, furostane, spirosolane, solanidane, or curcubitacin derivative. Solamargine is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Solamargine can be found in eggplant, which makes solamargine a potential biomarker for the consumption of this food product. Solamargine is a poisonous chemical compound that occurs in plants of the Solanaceae family, such as potatoes, tomatoes, and eggplants. It has been also isolated from Solanum nigrum fungal endophyte Aspergillus flavus. It is a glycoalkaloid derived from the steroidal alkaloid solasodine . |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1610.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[4-hydroxy-2-(hydroxymethyl)-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| Nih Violation | True |
| Class | Azaspirodecane derivatives |
| Xlogp | 1.1 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Molecular Formula | C45H73NO15 |
| Inchi Key | MBWUSSKCCUMJHO-UHFFFAOYSA-N |
| Rotatable Bond Count | 7.0 |
| Synonyms | Solamargine, beta-Solamarine, Solasonine, alpha-Solasonine, alpha-Solamarine, alpha-Solamarine, (3beta,22alpha,25R)-isomer |
| Compound Name | Solamarin, beta |
| Kingdom | Organic compounds |
| Exact Mass | 867.498 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 867.498 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 868.1 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 26.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Inchi | InChI=1S/C45H73NO15/c1-19-9-14-45(46-17-19)20(2)30-28(61-45)16-27-25-8-7-23-15-24(10-12-43(23,5)26(25)11-13-44(27,30)6)57-42-39(60-41-36(53)34(51)32(49)22(4)56-41)37(54)38(29(18-47)58-42)59-40-35(52)33(50)31(48)21(3)55-40/h7,19-22,24-42,46-54H,8-18H2,1-6H3 |
| Smiles | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)NC1 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Azaspirodecane derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Solanum Melongena (Plant) Rel Props:Source_db:fooddb_chem_all