CID 433869
PubChem CID: 433869
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Kaurenoic acid, 6730-83-2, 5,9-Dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid, NSC339145, NSC-339145, CHEMBL1968150, SCHEMBL18073589, BCP12731, B2703-458094, (-)-Kaur-16-en-18-oic acid, Cunabic acid, Kaurane-16-ene-18-oic acid, ent-Kaur-16(17)-en-19-oic acid, ent-Kaur-16-en-19-oic acid, (1R,4R,5S,9R,10S,13R)-5,9-Dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | NIKHGUQULKYIGE-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | (-)-16-Kauren-19-oic acid, Cunabic acid, ent-16-Kauren-19-oic acid, ent-Kaurenoic acid, Kaurenoic acid, Kaurenoate, ent-Kaur-16-en-18-Oic acid, Kaur-16-en-18-Oic acid, 3beta-Hydroxy-kaurenoic acid |
| Heavy Atom Count | 22.0 |
| Compound Name | CID 433869 |
| Kingdom | Organic compounds |
| Description | Kaurenoic acid, also known as kaur-16-en-18-oic acid or kaurenoate, is a member of the class of compounds known as kaurane diterpenoids. Kaurane diterpenoids are diterpene alkaloids with a structure that is based on the kaurane skeleton. Kaurane is a tetracyclic compound that arises by cyclisation of a pimarane precursor followed by rearrangement. It possesses a [3,2,1]-bicyclic ring system with C15-C16 bridge connected to C13, forming the five-membered ring D. Kaurenoic acid is practically insoluble (in water) and a weakly acidic compound (based on its pKa). Kaurenoic acid can be found in sunflower, which makes kaurenoic acid a potential biomarker for the consumption of this food product. |
| Exact Mass | 302.225 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 302.225 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 538.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 302.5 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5,9-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| Total Atom Stereocenter Count | 6.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C20H30O2/c1-13-11-20-10-7-15-18(2,16(20)6-5-14(13)12-20)8-4-9-19(15,3)17(21)22/h14-16H,1,4-12H2,2-3H3,(H,21,22) |
| Smiles | CC12CCCC(C1CCC34C2CCC(C3)C(=C)C4)(C)C(=O)O |
| Xlogp | 5.4 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Diterpenoids |
| Taxonomy Direct Parent | Kaurane diterpenoids |
| Molecular Formula | C20H30O2 |
- 1. Outgoing r'ship
FOUND_INto/from Helianthus Annuus (Plant) Rel Props:Source_db:fooddb_chem_all